![]() |
ERDDAP
Easier Access To GOOS Data |
|
Brought to you by GOOS OCG |
| Row Type | Variable Name | Attribute Name | Data Type | Value |
|---|---|---|---|---|
| attribute | NC_GLOBAL | cchdo_parameters_version | String | params 2025.4.0 |
| attribute | NC_GLOBAL | cchdo_software_version | String | hydro 1.0.2.15 |
| attribute | NC_GLOBAL | cdm_data_type | String | Profile |
| attribute | NC_GLOBAL | cdm_profile_variables | String | profile_id, expocode, section_id |
| attribute | NC_GLOBAL | comments | String | BOTTLE,20260330CCHSIOCBG\n Merged parameters: D18O_NO3, D15N_NO3\n For information on how to cite this dataset, please visit cchdo.ucsd.edu\nBOTTLE,20230128CCHSIOAMB\n Remove quote characters in comment lines\nBOTTLE,20220818CCHSIOAMB\n Change O18-O2 to D18O_NO3, N15-N2 to N15N_NO3, units of N2 to UMOL/KG, units of DELSI30 to /MILLE, Documented CDOM3C and CDOM2C\nBOTTLE,20210915CCHSIOCBG\n Merged parameters: TRITUM, TRITUM_FLAG_W, TRITER\n note: this is a correction of merge from 2016-02-16\n20140107CCHSIOCBG\n Merged parameters: TRITUM, TRITUM_FLAG_W, TRITER, HELIUM, HELIUM_FLAG_W, HELIER, DELHE3, DELHE3_FLAG_W, DELHER, NEON, NEON_FLAG_W, NEONER\n20140106CCHSIOCBG\n Merged parameters: TRITUM, TRITER, TRITUM_FLAG_W\n20131203CCHSIOCBG\n Merged parameters: DELC13, DELC13_FLAG_W\n20111215CCHDOSIOCBG\n remerge SILCAT with corrected units\nBOTTLE,20111214CCHDOSIOCBG\n SILCAT data merged from p18_nutrients.csv received from Eric Wisegarver on 2011-12-12\nBOTTLE,20111130CCHDOSIODM\n parameter name and flag corrections, PCO2 removed, see full note \nBOTTLE,20110517CCHDOSIOCBG\n PH_SWS, PH_TMP, PH_SWS_FLAG_W\nBOTTLE,20100913CCHDOSIOCBG\n Added FCO2, citations added by A. Barna\nBOTTLE,20090513CCHDOSIODM\n carbon, cfcs, nutrients, cdom added, see full note\nBOTTLE,20090511CCHDOSIODM\nRemove CDOM samples left from shipboard data set but not in Feb 2, 2009 CDOM update.\nBOTTLE,20090317CCHDOSIODM\nCDOM data merged from file ucsb_cdom_p18_s7a_20090130.txt received from Norman Nelson, UCSB, on Feb 2, 2009\nBOTTLE,20090305dm\nCarbon data merged from file p18_2007_DIC_TALK_PH_DOC_TDN_2008 received from Alex Kozyr, ORNL, on Nov 18, 2008\nCFC data merged from file CLIVAR_P18_CFCS_SF6_sentto_CCHDO_12Nov2008.txt received from John Bullister, PMEL, on Nov 11, 2008\nNutrient data merged from file P18_Nutrients_umol-kg.txt received from Calvin Mordy, PMEL, on Nov 21, 2008\nBOTTLE,20080925WHPSIOdm\nColumn heading line corrected from ,POC_FLAG_W.LAB_DEN LAB_DEN_FLAG_W, to ,POC_FLAG_W,LAB_DEN,LAB_DEN_FLAG_W,.\nBOTTLE,20080910WHPSIOdm\nBOTTLE,20080904WHPSIOdm\n\nBOTTLE,20160203PRINUNIVRMK\n SHIP: Ronald H. Brown \n Cruise: P18.2007; RB-07-11; RB-08-01 \n Region: Eastern Pacific meridional line \n EXPOCODE: 33RO20071215 \n DATES: 2007-12-15 to 2008-02-23 \n 177 stations with 24 place Rosette \n\n| For data citation, please use the data providers listed below. \n|\n| Programs and Principal Investigators\n| These data were provided by:\n|\n| PARAMETER/PROGRAM NAME EMAIL ADDRESS\n| ----------------- ---- --------------\n| Chief Scientist Leg 1 John L. Bullister-PMEL John.L.Bullister@noaa.gov\n| Chief Scientist Leg 2 Gregory C. Johnson-PMEL Gregory.D.Johnson@noaa.gov\n|\n| PARAMETER/PROGRAM Institution Principal Investigator email\n| ---------------------------------- --------------- ---------------------- --------------------------\n| CTDO/Salinity NOAA/PMEL Gregory C. Johnson Gregory.C.Johnson@noaa.gov\n| NOAA/AOML Molly Baringer Molly.Baringer@noaa.gov\n| Data Management UCSD/SIO James H. Swift jswift@ucsd.edu\n| Chlorofluorocarbons(CFCs) NOAA/PMEL John Bullister John.L.Bullister@noaa.gov\n| UWashington Mark Warner warner@u.washington.edu\n| Helium/Tritium/Neon WHOI William Jenkins wjenkins@whoi.edu \n| O2 NOAA/AOML Chris Langdon clangdon@rsmas.miami.edu\n| Total CO2(DIC)/pCO2 NOAA/PMEL Richard Feely Richard.A.Feely@noaa.gov\n| NOAA/AOML Rik Wanninkhof Rik.Wanninkhof@noaa.gov\n| Total Alkalinity/pH/Density UMiami Frank Millero fmillero@rsmas.miami.edu\n| Nutrients NOAA/PMEL Calvin Mordy Calvin.W.Mordy@noaa.gov\n| NOAA/AOML Jia-Zhong Zhang Jia-Zhong.Zhang@noaa.gov\n| CDOM/POC/Chlor.a UCSB Craig Carlson carlson@lifesci.ucsb.edu\n| 13C/14C UWashington Paul Quay pdquay@u.washington.edu\n| DOC UMiami Dennis Hansell dhansell@rsmas.miami.edu\n| DON UMass Mark Altabet maltabet@umassd.edu\n| Noble Gases (ONAR) UWashington Steve Emerson emerson@u.washington.edu\n| 30Si/28Si IGMR/ETH Zurich Ben Reynolds reynolds@erdw.ethz.ch\n| Transmissometer TAMU Wilf Gardner wgardner@ocean.tamu.edu\n| Lowered ADCP LDEO Andreas Thurnherr ant@ldeo.columbia.edu\n| Shipboard ADCP UHawaii Eric Firing efiring@hawaii.edu\n| TAO Servicing NOAA/NDBC Lex LeBlanc Lex.LeBlanc@noaa.gov\n| Argo Float deployments & XBT drops NOAA/PMEL Gregory C. Johnson Gregory.C.Johnson@noaa.gov\n| Drifter Deployment NOAA/AOML Shaun Dolk Shaun.Dolk@noaa.gov\n| Underway surface ocean, NOAA Ship personnel\n| meteorological and bathymetry data\n| |
| attribute | NC_GLOBAL | Conventions | String | CF-1.10, CCHDO-1.0, COARDS, ACDD-1.3, NCCSV-1.2 |
| attribute | NC_GLOBAL | Easternmost_Easting | double | 179.9997 |
| attribute | NC_GLOBAL | featureType | String | Profile |
| attribute | NC_GLOBAL | geospatial_lat_max | double | 90.0 |
| attribute | NC_GLOBAL | geospatial_lat_min | double | -78.638 |
| attribute | NC_GLOBAL | geospatial_lat_units | String | degrees_north |
| attribute | NC_GLOBAL | geospatial_lon_max | double | 179.9997 |
| attribute | NC_GLOBAL | geospatial_lon_min | double | -179.9983 |
| attribute | NC_GLOBAL | geospatial_lon_units | String | degrees_east |
| attribute | NC_GLOBAL | geospatial_vertical_max | double | 9460.0 |
| attribute | NC_GLOBAL | geospatial_vertical_min | double | -100.0 |
| attribute | NC_GLOBAL | geospatial_vertical_positive | String | down |
| attribute | NC_GLOBAL | geospatial_vertical_units | String | m |
| attribute | NC_GLOBAL | infoUrl | String | https://cchdo.ucsd.edu/
|
| attribute | NC_GLOBAL | institution | String | CCHDO |
| attribute | NC_GLOBAL | keywords | String | active, activity, alkalinity, ammonia, ammonium, ammonium_error, ammonium_qc, analysis, aphotic, arbitrary, argon, argon_error, argon_l, argon_l_qc, argon_qc, atmosphere, atmospheric, attenuance, attenuation, available, barium, barium_l, barium_l_qc, barium_qc, bbp700, beam, below, beta700, bottle, bottle_number, bottle_number_qc, bottle_salinity, bottle_salinity_qc, bottle_time, carbon, carbon_tetrachloride, carbon_tetrachloride_error, carbon_tetrachloride_l, carbon_tetrachloride_l_qc, carbon_tetrachloride_qc, cast, cdom, cdomsl, cdomsl_qc, cdomsn, cdomsn_qc, cfc, cfc11, cfc_11, cfc_113, cfc_113_error, cfc_113_l, cfc_113_l_qc, cfc_113_qc, cfc_11_error, cfc_11_l, cfc_11_l_qc, cfc_11_qc, cfc_12, cfc_12_error, cfc_12_l, cfc_12_l_qc, cfc_12_qc, chemistry, chloroflourocarbon, chlorofluorocarbons, chlorophyll, chlorophyll_a, chlorophyll_a_qc, chlorophyll_a_ug_kg, chlorophyll_a_ug_kg_qc, coefficient, colored, concentration, concentration_of_colored_dissolved_organic_matter_in_sea_water_expressed_as_equivalent_mass_fraction_of_quinine_sulfate_dihydrate, conductivity, container, corrected, ctd, ctd_bbp700, ctd_bbp700_qc, ctd_beamcp, ctd_beamcp_qc, ctd_beta700, ctd_beta700_qc, ctd_beta700_raw, ctd_beta700_raw_qc, ctd_cdom, ctd_cdom_qc, ctd_cdom_raw, ctd_cdom_raw_qc, ctd_fluor, ctd_fluor_arbitrary, ctd_fluor_arbitrary_qc, ctd_fluor_qc, ctd_fluor_raw, ctd_fluor_raw_qc, ctd_oxygen, ctd_oxygen_ml_l, ctd_oxygen_ml_l_qc, ctd_oxygen_qc, ctd_oxygen_umol_l, ctd_oxygen_umol_l_qc, ctd_salinity, ctd_salinity_qc, ctd_temperature, ctd_temperature_68, ctd_temperature_68_qc, ctd_temperature_qc, ctd_temperature_unk, ctd_temperature_unk_qc, ctd_transmissometer, ctd_transmissometer_qc, ctd_transmissometer_raw, ctd_transmissometer_raw_qc, ctd_turbidity_ftu, ctd_turbidity_ftu_qc, ctd_turbidity_ntu, ctd_turbidity_ntu_qc, ctd_turbidity_raw, ctd_turbidity_raw_qc, d15n, d15n_nitrite_nitrate, d15n_nitrite_nitrate_error, d15n_nitrite_nitrate_qc, d15n_no3, d15n_no3_error, d15n_no3_qc, d18o, d18o_nitrate, d18o_nitrate_error, d18o_nitrate_qc, d18o_nitrite_nitrate, d18o_nitrite_nitrate_error, d18o_nitrite_nitrate_qc, data, del, del_carbon_13_dic, del_carbon_13_dic_error, del_carbon_13_dic_qc, del_carbon_14_dic, del_carbon_14_dic_error, del_carbon_14_dic_qc, del_oxygen_18, del_oxygen_18_error, del_oxygen_18_qc, delta, delta_helium_3, delta_helium_3_error, delta_helium_3_qc, density, depth, dic, dihydrate, dioxide, dissolved, dissolved_organic_carbon, dissolved_organic_carbon_qc, dissolved_organic_nitrogen, dissolved_organic_nitrogen_qc, downwelling, downwelling_photosynthetic_photon_flux_in_sea_water, earth, Earth Science > Atmosphere > Atmospheric Chemistry > Halocarbons And Halogens, Earth Science > Atmosphere > Atmospheric Chemistry > Halocarbons And Halogens > Chlorofluorocarbons, Earth Science > Oceans > Ocean Chemistry > Ammonia, Earth Science > Oceans > Ocean Chemistry > Chlorophyll, Earth Science > Oceans > Ocean Chemistry > Nitrate, Earth Science > Oceans > Ocean Chemistry > Nitrite, Earth Science > Oceans > Ocean Chemistry > Nitrogen, Earth Science > Oceans > Ocean Chemistry > Oxygen, Earth Science > Oceans > Ocean Chemistry > pH, Earth Science > Oceans > Ocean Chemistry > Phosphate, Earth Science > Oceans > Ocean Chemistry > Silicate, Earth Science > Oceans > Ocean Optics > Aphotic/Photic Zone, Earth Science > Oceans > Ocean Optics > Photosynthetically Active Radiation, Earth Science > Oceans > Ocean Optics > Radiance, Earth Science > Oceans > Ocean Pressure > Water Pressure, Earth Science > Oceans > Ocean Temperature > Water Temperature, Earth Science > Oceans > Salinity/Density > Salinity, equivalent, error, expocode, expressed, fco2, fco2_qc, fco2_temperature, fco2_temperature_qc, flag, floor, fluor, flux, fraction, ftu, fugacity, fugacity_of_carbon_dioxide_in_sea_water, function, geometry, geometry_container, halocarbons, halogens, helium, helium_error, helium_l, helium_l_qc, helium_qc, hexifluoride, inorganic, krypton, krypton_error, krypton_l, krypton_l_error, krypton_l_qc, krypton_qc, latitude, levels, line, line_id, local, longitude, mass, mass_concentration_of_chlorophyll_a_in_sea_water, mass_concentration_of_chlorophyll_in_sea_water, mass_fraction_of_chlorophyll_a_in_sea_water, matter, mol, mole, mole_concentration_of_ammonium_in_sea_water, mole_concentration_of_dissolved_molecular_oxygen_in_sea_water, mole_concentration_of_nitrate_and_nitrite_in_sea_water, mole_concentration_of_nitrate_in_sea_water, mole_concentration_of_nitrate_in_sea_water standard_error, mole_concentration_of_nitrite_in_sea_water, mole_concentration_of_nitrite_in_sea_water standard_error, mole_concentration_of_phosphate_in_sea_water, mole_concentration_of_phosphate_in_sea_water standard_error, mole_concentration_of_silicate_in_sea_water, molecular, moles, moles_of_cfc11_per_unit_mass_in_sea_water, moles_of_cfc11_per_unit_mass_in_sea_water standard_error, moles_of_dissolved_inorganic_carbon_per_unit_mass_in_sea_water, moles_of_nitrate_and_nitrite_per_unit_mass_in_sea_water, moles_of_nitrate_per_unit_mass_in_sea_water, moles_of_nitrate_per_unit_mass_in_sea_water standard_error, moles_of_nitrite_per_unit_mass_in_sea_water, moles_of_nitrite_per_unit_mass_in_sea_water standard_error, moles_of_oxygen_per_unit_mass_in_sea_water, moles_of_phosphate_per_unit_mass_in_sea_water, moles_of_phosphate_per_unit_mass_in_sea_water standard_error, moles_of_silicate_per_unit_mass_in_sea_water, moles_of_silicate_per_unit_mass_in_sea_water standard_error, n02, N_LEVELS, N_PROF, nh4, nitrate, nitrate_error, nitrate_l, nitrate_l_error, nitrate_l_qc, nitrate_qc, nitrite, nitrite_error, nitrite_l, nitrite_l_error, nitrite_l_qc, nitrite_nitrate, nitrite_nitrate_l, nitrite_nitrate_l_qc, nitrite_nitrate_qc, nitrite_qc, nitrogen, nitrous, nitrous_oxide, nitrous_oxide_l, nitrous_oxide_l_qc, nitrous_oxide_qc, no3, number, O2, ocean, oceans, optics, organic, oxide, oxygen, oxygen_ml_l, oxygen_ml_l_qc, oxygen_qc, par, par_qc, par_raw, par_raw_qc, partial, partial_co2_temperature, partial_co2_temperature_qc, partial_pressure_of_carbon_dioxide_in_sea_water, partial_pressure_of_co2, partial_pressure_of_co2_qc, particulate, particulate_organic_carbon, particulate_organic_carbon_l, particulate_organic_carbon_l_qc, particulate_organic_carbon_qc, particulate_organic_nitrogen, particulate_organic_nitrogen_l, particulate_organic_nitrogen_l_qc, particulate_organic_nitrogen_mol, particulate_organic_nitrogen_mol_qc, particulate_organic_nitrogen_qc, per, ph_sws, ph_sws_qc, ph_temperature, ph_temperature_qc, ph_total_h_scale, ph_total_h_scale_qc, ph_unknown_scale, ph_unknown_scale_qc, phaeophytin, phaeophytin_qc, phaeophytin_ug_l, phaeophytin_ug_l_qc, phosphate, phosphate_error, phosphate_l, phosphate_l_error, phosphate_l_qc, phosphate_qc, photic, photon, photosynthetic, photosynthetically, po4, practical, pressure, prof, profile, profile_type, pure, quinine, radiance, radiation, radiative, radium, radium_226, radium_226_error, radium_226_qc, radium_228, radium_228_error, radium_228_qc, raw, ref_temperature, ref_temperature_c, ref_temperature_c_qc, ref_temperature_qc, reported, rev_pressure, rev_pressure_qc, rev_temperature, rev_temperature_90, rev_temperature_90_qc, rev_temperature_c, rev_temperature_c_qc, rev_temperature_qc, salinity, sample, scale, scattering, science, sea, sea_water_ph_reported_on_total_scale, sea_water_practical_salinity, sea_water_pressure, sea_water_temperature, sea_water_turbidity, seawater, section, section_id, silicate, silicate_error, silicate_l, silicate_l_qc, silicate_qc, sonde, source, standard, station, status, status_flag, sulfate, sulfur, sulfur_hexifluoride, sulfur_hexifluoride_l, sulfur_hexifluoride_l_qc, sulfur_hexifluoride_qc, surface, sws, temperature, temperature_of_analysis_of_sea_water, tetrachloride, time, total, total_alkalinity, total_alkalinity_qc, total_carbon, total_carbon_qc, total_dissolved_nitrogen, total_dissolved_nitrogen_qc, total_organic_carbon, total_organic_carbon_l, total_organic_carbon_l_qc, total_organic_carbon_qc, transmissometer, tritium, tritium_activity, tritium_activity_error, tritium_activity_qc, tritium_error, tritium_qc, turbidity, type, unit, volume, volume_beam_attenuation_coefficient_of_radiative_flux_in_sea_water_corrected_for_pure_water_attenuance, volume_fraction_of_oxygen_in_sea_water, volume_scattering_function_of_radiative_flux_in_sea_water, water, xenon, xenon_error, xenon_l, xenon_l_error, xenon_l_qc, xenon_qc, zone |
| attribute | NC_GLOBAL | keywords_vocabulary | String | GCMD Science Keywords |
| attribute | NC_GLOBAL | license | String | These data were produced by NOAA and are not subject to copyright protection in the United States. NOAA waives any potential copyright and related rights in these data worldwide through the Creative Commons Zero 1.0 Universal Public Domain Dedication (CC0-1.0). |
| attribute | NC_GLOBAL | Northernmost_Northing | double | 90.0 |
| attribute | NC_GLOBAL | sourceUrl | String | (local files) |
| attribute | NC_GLOBAL | Southernmost_Northing | double | -78.638 |
| attribute | NC_GLOBAL | standard_name_vocabulary | String | CF Standard Name Table v70 |
| attribute | NC_GLOBAL | subsetVariables | String | expocode |
| attribute | NC_GLOBAL | summary | String | CCHDO GO SHIP bottle data from netcdf |
| attribute | NC_GLOBAL | time_coverage_end | String | 2025-04-23T13:43:00Z |
| attribute | NC_GLOBAL | time_coverage_start | String | 1972-07-24T09:11:00Z |
| attribute | NC_GLOBAL | title | String | CCHDO GO SHIP bottle data |
| attribute | NC_GLOBAL | Westernmost_Easting | double | -179.9983 |
| variable | profile_id | String | ||
| attribute | profile_id | cf_role | String | profile_id |
| attribute | profile_id | long_name | String | Unique Profile ID |
| variable | expocode | String | ||
| attribute | expocode | geometry | String | geometry_container |
| attribute | expocode | long_name | String | Expocode |
| attribute | expocode | whp_name | String | EXPOCODE |
| variable | section_id | String | ||
| attribute | section_id | geometry | String | geometry_container |
| attribute | section_id | long_name | String | Section Id |
| attribute | section_id | whp_name | String | SECT_ID |
| variable | line_id | String | ||
| attribute | line_id | long_name | String | Line Id |
| variable | station | String | ||
| attribute | station | geometry | String | geometry_container |
| attribute | station | long_name | String | Station |
| attribute | station | whp_name | String | STNNBR |
| variable | cast | int | ||
| attribute | cast | _FillValue | int | 2147483647 |
| attribute | cast | actual_range | int | 0, 8420 |
| attribute | cast | geometry | String | geometry_container |
| attribute | cast | long_name | String | Cast |
| attribute | cast | whp_name | String | CASTNO |
| variable | sample | String | ||
| attribute | sample | long_name | String | Sample |
| attribute | sample | whp_name | String | SAMPNO |
| variable | bottle_number | String | ||
| attribute | bottle_number | ancillary_variables | String | bottle_number_qc |
| attribute | bottle_number | long_name | String | Bottle Number |
| attribute | bottle_number | whp_name | String | BTLNBR |
| variable | bottle_number_qc | byte | ||
| attribute | bottle_number_qc | _FillValue | byte | 9 |
| attribute | bottle_number_qc | actual_range | byte | 0, 25 |
| attribute | bottle_number_qc | colorBarMaximum | double | 10.0 |
| attribute | bottle_number_qc | colorBarMinimum | double | 0.0 |
| attribute | bottle_number_qc | conventions | String | WOCESAMPLE - WOCE Quality Codes for the sampling device itself |
| attribute | bottle_number_qc | flag_meanings | String | no_flag_assigned bottle_information_unavailable no_problems_noted leaking did_not_trip_correctly not_reported significant_discrepancy_in_measured_values_between_gerard_and_niskin_bottles unknown_problem pair_did_not_trip_correctly_note_that_the_niskin_bottle_can_trip_at_an_unplanned_depth_while_the_gerard_trips_correctly_and_vice_versa samples_not_drawn_from_this_bottle |
| attribute | bottle_number_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | bottle_number_qc | long_name | String | Status Flag |
| attribute | bottle_number_qc | standard_name | String | status_flag |
| variable | time | double | ||
| attribute | time | _CoordinateAxisType | String | Time |
| attribute | time | actual_range | double | 8.081706E7, 1.74541578E9 |
| attribute | time | axis | String | T |
| attribute | time | calendar | String | gregorian |
| attribute | time | geometry | String | geometry_container |
| attribute | time | ioos_category | String | Time |
| attribute | time | long_name | String | Time |
| attribute | time | standard_name | String | time |
| attribute | time | time_origin | String | 01-JAN-1970 00:00:00 |
| attribute | time | units | String | seconds since 1970-01-01T00:00:00Z |
| attribute | time | whp_name | String | DATE\nTIME |
| variable | latitude | double | ||
| attribute | latitude | _CoordinateAxisType | String | Lat |
| attribute | latitude | actual_range | double | -78.638, 90.0 |
| attribute | latitude | axis | String | Y |
| attribute | latitude | C_format | String | %.4f |
| attribute | latitude | C_format_source | String | input_file |
| attribute | latitude | colorBarMaximum | double | 90.0 |
| attribute | latitude | colorBarMinimum | double | -90.0 |
| attribute | latitude | ioos_category | String | Location |
| attribute | latitude | long_name | String | Latitude |
| attribute | latitude | standard_name | String | latitude |
| attribute | latitude | units | String | degrees_north |
| attribute | latitude | whp_name | String | LATITUDE |
| variable | longitude | double | ||
| attribute | longitude | _CoordinateAxisType | String | Lon |
| attribute | longitude | actual_range | double | -179.9983, 179.9997 |
| attribute | longitude | axis | String | X |
| attribute | longitude | C_format | String | %.4f |
| attribute | longitude | C_format_source | String | input_file |
| attribute | longitude | colorBarMaximum | double | 180.0 |
| attribute | longitude | colorBarMinimum | double | -180.0 |
| attribute | longitude | ioos_category | String | Location |
| attribute | longitude | long_name | String | Longitude |
| attribute | longitude | standard_name | String | longitude |
| attribute | longitude | units | String | degrees_east |
| attribute | longitude | whp_name | String | LONGITUDE |
| variable | longitude360 | double | ||
| attribute | longitude360 | actual_range | double | 0.0, 359.9999 |
| attribute | longitude360 | long_name | String | longitude 0-360 |
| attribute | longitude360 | standard_name | String | longitude |
| attribute | longitude360 | units | String | degrees_east |
| variable | depth | double | ||
| attribute | depth | _CoordinateAxisType | String | Height |
| attribute | depth | _CoordinateZisPositive | String | down |
| attribute | depth | _FillValue | double | NaN |
| attribute | depth | actual_range | double | -100.0, 9460.0 |
| attribute | depth | axis | String | Z |
| attribute | depth | C_format | String | %.0f |
| attribute | depth | C_format_source | String | input_file |
| attribute | depth | colorBarMaximum | double | 8000.0 |
| attribute | depth | colorBarMinimum | double | -8000.0 |
| attribute | depth | colorBarPalette | String | TopographyDepth |
| attribute | depth | ioos_category | String | Location |
| attribute | depth | long_name | String | Sea Floor Depth Below Sea Surface |
| attribute | depth | missing_value | double | NaN |
| attribute | depth | positive | String | down |
| attribute | depth | source_name | String | btm_depth |
| attribute | depth | standard_name | String | depth |
| attribute | depth | units | String | m |
| attribute | depth | whp_name | String | DEPTH |
| attribute | depth | whp_unit | String | METERS |
| variable | pressure | double | ||
| attribute | pressure | _FillValue | double | NaN |
| attribute | pressure | actual_range | double | -14.3, 7921.5 |
| attribute | pressure | axis | String | Z |
| attribute | pressure | C_format | String | %.1f |
| attribute | pressure | C_format_source | String | input_file |
| attribute | pressure | colorBarMaximum | double | 5000.0 |
| attribute | pressure | colorBarMinimum | double | 0.0 |
| attribute | pressure | long_name | String | Sea Water Pressure |
| attribute | pressure | positive | String | down |
| attribute | pressure | standard_name | String | sea_water_pressure |
| attribute | pressure | units | String | dbar |
| attribute | pressure | whp_name | String | CTDPRS |
| attribute | pressure | whp_unit | String | DBAR |
| variable | ctd_temperature_unk | double | ||
| attribute | ctd_temperature_unk | actual_range | double | -2.134, 32.76 |
| attribute | ctd_temperature_unk | colorBarMaximum | double | 32.0 |
| attribute | ctd_temperature_unk | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature_unk | long_name | String | Sea Water Temperature |
| attribute | ctd_temperature_unk | missing_value | double | NaN |
| attribute | ctd_temperature_unk | units | String | degree_C |
| variable | ctd_temperature_unk_qc | byte | ||
| attribute | ctd_temperature_unk_qc | actual_range | byte | 2, 5 |
| attribute | ctd_temperature_unk_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_temperature_unk_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature_unk_qc | long_name | String | Status Flag |
| variable | ctd_temperature_68 | double | ||
| attribute | ctd_temperature_68 | actual_range | double | -1.8941, 30.101 |
| attribute | ctd_temperature_68 | colorBarMaximum | double | 32.0 |
| attribute | ctd_temperature_68 | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature_68 | long_name | String | Sea Water Temperature |
| attribute | ctd_temperature_68 | missing_value | double | NaN |
| attribute | ctd_temperature_68 | units | String | degree_C |
| variable | ctd_temperature_68_qc | byte | ||
| attribute | ctd_temperature_68_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_temperature_68_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature_68_qc | long_name | String | Status Flag |
| variable | ctd_temperature | double | ||
| attribute | ctd_temperature | _FillValue | double | NaN |
| attribute | ctd_temperature | actual_range | double | -9.0, 35.057 |
| attribute | ctd_temperature | C_format | String | %.4f |
| attribute | ctd_temperature | C_format_source | String | input_file |
| attribute | ctd_temperature | colorBarMaximum | double | 32.0 |
| attribute | ctd_temperature | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature | long_name | String | Sea Water Temperature |
| attribute | ctd_temperature | missing_value | double | NaN |
| attribute | ctd_temperature | reference_scale | String | ITS-90 |
| attribute | ctd_temperature | standard_name | String | sea_water_temperature |
| attribute | ctd_temperature | units | String | degree_C |
| attribute | ctd_temperature | whp_name | String | CTDTMP |
| attribute | ctd_temperature | whp_unit | String | ITS-90 |
| variable | ctd_temperature_qc | byte | ||
| attribute | ctd_temperature_qc | actual_range | byte | 1, 4 |
| attribute | ctd_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_temperature_qc | long_name | String | Status Flag |
| variable | ctd_salinity | double | ||
| attribute | ctd_salinity | _FillValue | double | NaN |
| attribute | ctd_salinity | actual_range | double | -9.0, 12623.22 |
| attribute | ctd_salinity | ancillary_variables | String | ctd_salinity_qc |
| attribute | ctd_salinity | C_format | String | %.4f |
| attribute | ctd_salinity | C_format_source | String | input_file |
| attribute | ctd_salinity | colorBarMaximum | double | 37.0 |
| attribute | ctd_salinity | colorBarMinimum | double | 32.0 |
| attribute | ctd_salinity | long_name | String | Sea Water Practical Salinity |
| attribute | ctd_salinity | missing_value | double | NaN |
| attribute | ctd_salinity | reference_scale | String | PSS-78 |
| attribute | ctd_salinity | standard_name | String | sea_water_practical_salinity |
| attribute | ctd_salinity | units | String | 1 |
| attribute | ctd_salinity | whp_name | String | CTDSAL |
| attribute | ctd_salinity | whp_unit | String | PSS-78 |
| variable | ctd_salinity_qc | byte | ||
| attribute | ctd_salinity_qc | _FillValue | byte | 9 |
| attribute | ctd_salinity_qc | actual_range | byte | 0, 25 |
| attribute | ctd_salinity_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_salinity_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_salinity_qc | conventions | String | WOCECTD - WOCE Quality Codes for CTD instrument measurements |
| attribute | ctd_salinity_qc | flag_meanings | String | no_flag_assigned not_calibrated acceptable_measurement questionable_measurement bad_measurement not_reported interpolated_over_a_pressure_interval_larger_than_2_dbar despiked not_sampled |
| attribute | ctd_salinity_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 9 |
| attribute | ctd_salinity_qc | long_name | String | Status Flag |
| attribute | ctd_salinity_qc | standard_name | String | status_flag |
| variable | bottle_salinity | double | ||
| attribute | bottle_salinity | _FillValue | double | NaN |
| attribute | bottle_salinity | actual_range | double | -9.9999, 44.2448 |
| attribute | bottle_salinity | ancillary_variables | String | bottle_salinity_qc |
| attribute | bottle_salinity | C_format | String | %.4f |
| attribute | bottle_salinity | C_format_source | String | input_file |
| attribute | bottle_salinity | colorBarMaximum | double | 37.0 |
| attribute | bottle_salinity | colorBarMinimum | double | 32.0 |
| attribute | bottle_salinity | long_name | String | Sea Water Practical Salinity |
| attribute | bottle_salinity | missing_value | double | NaN |
| attribute | bottle_salinity | reference_scale | String | PSS-78 |
| attribute | bottle_salinity | standard_name | String | sea_water_practical_salinity |
| attribute | bottle_salinity | units | String | 1 |
| attribute | bottle_salinity | whp_name | String | SALNTY |
| attribute | bottle_salinity | whp_unit | String | PSS-78 |
| variable | bottle_salinity_qc | byte | ||
| attribute | bottle_salinity_qc | _FillValue | byte | 9 |
| attribute | bottle_salinity_qc | actual_range | byte | 0, 32 |
| attribute | bottle_salinity_qc | colorBarMaximum | double | 10.0 |
| attribute | bottle_salinity_qc | colorBarMinimum | double | 0.0 |
| attribute | bottle_salinity_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | bottle_salinity_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | bottle_salinity_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | bottle_salinity_qc | long_name | String | Status Flag |
| attribute | bottle_salinity_qc | standard_name | String | status_flag |
| variable | ctd_oxygen_ml_l | double | ||
| attribute | ctd_oxygen_ml_l | actual_range | double | 2.7, 8.4 |
| attribute | ctd_oxygen_ml_l | colorBarMaximum | double | 1.0 |
| attribute | ctd_oxygen_ml_l | colorBarMinimum | double | 0.0 |
| attribute | ctd_oxygen_ml_l | long_name | String | Volume Fraction Of Oxygen In Sea Water |
| attribute | ctd_oxygen_ml_l | missing_value | double | NaN |
| variable | ctd_oxygen_ml_l_qc | byte | ||
| attribute | ctd_oxygen_ml_l_qc | actual_range | byte | 2, 5 |
| attribute | ctd_oxygen_ml_l_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_oxygen_ml_l_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_oxygen_ml_l_qc | long_name | String | Status Flag |
| variable | ctd_oxygen | double | ||
| attribute | ctd_oxygen | _FillValue | double | NaN |
| attribute | ctd_oxygen | actual_range | double | -200.4, 4222.0 |
| attribute | ctd_oxygen | ancillary_variables | String | ctd_oxygen_qc |
| attribute | ctd_oxygen | C_format | String | %.1f |
| attribute | ctd_oxygen | C_format_source | String | input_file |
| attribute | ctd_oxygen | long_name | String | Moles Of Oxygen Per Unit Mass In Sea Water |
| attribute | ctd_oxygen | missing_value | double | NaN |
| attribute | ctd_oxygen | standard_name | String | moles_of_oxygen_per_unit_mass_in_sea_water |
| attribute | ctd_oxygen | units | String | µmole/kg |
| attribute | ctd_oxygen | whp_name | String | CTDOXY |
| attribute | ctd_oxygen | whp_unit | String | UMOL/KG |
| variable | ctd_oxygen_qc | byte | ||
| attribute | ctd_oxygen_qc | _FillValue | byte | 9 |
| attribute | ctd_oxygen_qc | actual_range | byte | 0, 7 |
| attribute | ctd_oxygen_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_oxygen_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_oxygen_qc | conventions | String | WOCECTD - WOCE Quality Codes for CTD instrument measurements |
| attribute | ctd_oxygen_qc | flag_meanings | String | no_flag_assigned not_calibrated acceptable_measurement questionable_measurement bad_measurement not_reported interpolated_over_a_pressure_interval_larger_than_2_dbar despiked not_sampled |
| attribute | ctd_oxygen_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 9 |
| attribute | ctd_oxygen_qc | long_name | String | Status Flag |
| attribute | ctd_oxygen_qc | standard_name | String | status_flag |
| variable | ctd_oxygen_umol_l | double | ||
| attribute | ctd_oxygen_umol_l | colorBarMaximum | double | 500.0 |
| attribute | ctd_oxygen_umol_l | colorBarMinimum | double | 0.0 |
| attribute | ctd_oxygen_umol_l | long_name | String | Mole Concentration Of Dissolved Molecular Oxygen In Sea Water |
| attribute | ctd_oxygen_umol_l | missing_value | double | NaN |
| variable | ctd_oxygen_umol_l_qc | byte | ||
| attribute | ctd_oxygen_umol_l_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_oxygen_umol_l_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_oxygen_umol_l_qc | long_name | String | Status Flag |
| variable | oxygen_ml_l | double | ||
| attribute | oxygen_ml_l | actual_range | double | 0.4, 11.2 |
| attribute | oxygen_ml_l | colorBarMaximum | double | 1.0 |
| attribute | oxygen_ml_l | colorBarMinimum | double | 0.0 |
| attribute | oxygen_ml_l | long_name | String | Volume Fraction Of Oxygen In Sea Water |
| attribute | oxygen_ml_l | missing_value | double | NaN |
| variable | oxygen_ml_l_qc | byte | ||
| attribute | oxygen_ml_l_qc | actual_range | byte | 2, 5 |
| attribute | oxygen_ml_l_qc | colorBarMaximum | double | 10.0 |
| attribute | oxygen_ml_l_qc | colorBarMinimum | double | 0.0 |
| attribute | oxygen_ml_l_qc | long_name | String | Status Flag |
| variable | oxygen | double | ||
| attribute | oxygen | _FillValue | double | NaN |
| attribute | oxygen | actual_range | double | -19162.8, 6735.9 |
| attribute | oxygen | ancillary_variables | String | oxygen_qc |
| attribute | oxygen | C_format | String | %.1f |
| attribute | oxygen | C_format_source | String | input_file |
| attribute | oxygen | long_name | String | Moles Of Oxygen Per Unit Mass In Sea Water |
| attribute | oxygen | missing_value | double | NaN |
| attribute | oxygen | standard_name | String | moles_of_oxygen_per_unit_mass_in_sea_water |
| attribute | oxygen | units | String | µmole/kg |
| attribute | oxygen | whp_name | String | OXYGEN |
| attribute | oxygen | whp_unit | String | UMOL/KG |
| variable | oxygen_qc | byte | ||
| attribute | oxygen_qc | _FillValue | byte | 9 |
| attribute | oxygen_qc | actual_range | byte | 0, 25 |
| attribute | oxygen_qc | colorBarMaximum | double | 10.0 |
| attribute | oxygen_qc | colorBarMinimum | double | 0.0 |
| attribute | oxygen_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | oxygen_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | oxygen_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | oxygen_qc | long_name | String | Status Flag |
| attribute | oxygen_qc | standard_name | String | status_flag |
| variable | silicate | double | ||
| attribute | silicate | _FillValue | double | NaN |
| attribute | silicate | actual_range | double | -9.0, 694.61 |
| attribute | silicate | ancillary_variables | String | silicate_qc |
| attribute | silicate | C_format | String | %.2f |
| attribute | silicate | C_format_source | String | input_file |
| attribute | silicate | long_name | String | Moles Of Silicate Per Unit Mass In Sea Water |
| attribute | silicate | missing_value | double | NaN |
| attribute | silicate | standard_name | String | moles_of_silicate_per_unit_mass_in_sea_water |
| attribute | silicate | units | String | µmole/kg |
| attribute | silicate | whp_name | String | SILCAT |
| attribute | silicate | whp_unit | String | UMOL/KG |
| variable | silicate_qc | byte | ||
| attribute | silicate_qc | _FillValue | byte | 9 |
| attribute | silicate_qc | actual_range | byte | 0, 25 |
| attribute | silicate_qc | colorBarMaximum | double | 10.0 |
| attribute | silicate_qc | colorBarMinimum | double | 0.0 |
| attribute | silicate_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | silicate_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | silicate_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | silicate_qc | long_name | String | Status Flag |
| attribute | silicate_qc | standard_name | String | status_flag |
| variable | silicate_error | double | ||
| attribute | silicate_error | actual_range | double | 0.02, 57.71 |
| attribute | silicate_error | colorBarMaximum | double | 50.0 |
| attribute | silicate_error | colorBarMinimum | double | 0.0 |
| attribute | silicate_error | long_name | String | Moles Of Silicate Per Unit Mass In Sea Water Standard Error |
| attribute | silicate_error | missing_value | double | NaN |
| attribute | silicate_error | units | String | µmole/kg |
| variable | silicate_l | double | ||
| attribute | silicate_l | actual_range | double | -0.4, 135.2 |
| attribute | silicate_l | colorBarMaximum | double | 50.0 |
| attribute | silicate_l | colorBarMinimum | double | 0.0 |
| attribute | silicate_l | long_name | String | Mole Concentration Of Silicate In Sea Water |
| attribute | silicate_l | missing_value | double | NaN |
| variable | silicate_l_qc | byte | ||
| attribute | silicate_l_qc | actual_range | byte | 2, 5 |
| attribute | silicate_l_qc | colorBarMaximum | double | 10.0 |
| attribute | silicate_l_qc | colorBarMinimum | double | 0.0 |
| attribute | silicate_l_qc | long_name | String | Status Flag |
| variable | ammonium | double | ||
| attribute | ammonium | actual_range | double | -0.3, 75.9 |
| attribute | ammonium | colorBarMaximum | double | 5.0 |
| attribute | ammonium | colorBarMinimum | double | 0.0 |
| attribute | ammonium | long_name | String | Mole Concentration Of Ammonium In Sea Water |
| attribute | ammonium | missing_value | double | NaN |
| attribute | ammonium | standard_name | String | mole_concentration_of_ammonium_in_sea_water |
| attribute | ammonium | units | String | µmole/kg |
| variable | ammonium_qc | byte | ||
| attribute | ammonium_qc | actual_range | byte | 2, 25 |
| attribute | ammonium_qc | colorBarMaximum | double | 10.0 |
| attribute | ammonium_qc | colorBarMinimum | double | 0.0 |
| attribute | ammonium_qc | long_name | String | Status Flag |
| variable | ammonium_error | double | ||
| attribute | ammonium_error | actual_range | double | 0.01, 0.52 |
| attribute | ammonium_error | colorBarMaximum | double | 50.0 |
| attribute | ammonium_error | colorBarMinimum | double | 0.0 |
| attribute | ammonium_error | long_name | String | Ammonium Error |
| attribute | ammonium_error | missing_value | double | NaN |
| attribute | ammonium_error | units | String | µmole/kg |
| variable | nitrate | double | ||
| attribute | nitrate | _FillValue | double | NaN |
| attribute | nitrate | actual_range | double | -9.0, 97.59 |
| attribute | nitrate | ancillary_variables | String | nitrate_qc |
| attribute | nitrate | C_format | String | %.2f |
| attribute | nitrate | C_format_source | String | input_file |
| attribute | nitrate | long_name | String | Moles Of Nitrate Per Unit Mass In Sea Water |
| attribute | nitrate | missing_value | double | NaN |
| attribute | nitrate | standard_name | String | moles_of_nitrate_per_unit_mass_in_sea_water |
| attribute | nitrate | units | String | µmole/kg |
| attribute | nitrate | whp_name | String | NITRAT |
| attribute | nitrate | whp_unit | String | UMOL/KG |
| variable | nitrate_qc | byte | ||
| attribute | nitrate_qc | _FillValue | byte | 9 |
| attribute | nitrate_qc | actual_range | byte | 0, 25 |
| attribute | nitrate_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrate_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrate_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | nitrate_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | nitrate_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | nitrate_qc | long_name | String | Status Flag |
| attribute | nitrate_qc | standard_name | String | status_flag |
| variable | nitrate_error | double | ||
| attribute | nitrate_error | actual_range | double | 0.0, 8.56 |
| attribute | nitrate_error | colorBarMaximum | double | 50.0 |
| attribute | nitrate_error | colorBarMinimum | double | 0.0 |
| attribute | nitrate_error | long_name | String | Moles Of Nitrate Per Unit Mass In Sea Water Standard Error |
| attribute | nitrate_error | missing_value | double | NaN |
| attribute | nitrate_error | units | String | µmole/kg |
| variable | nitrate_l | double | ||
| attribute | nitrate_l | colorBarMaximum | double | 50.0 |
| attribute | nitrate_l | colorBarMinimum | double | 0.0 |
| attribute | nitrate_l | long_name | String | Mole Concentration Of Nitrate In Sea Water |
| attribute | nitrate_l | missing_value | double | NaN |
| variable | nitrate_l_qc | byte | ||
| attribute | nitrate_l_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrate_l_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrate_l_qc | long_name | String | Status Flag |
| variable | nitrate_l_error | double | ||
| attribute | nitrate_l_error | colorBarMaximum | double | 0.1 |
| attribute | nitrate_l_error | colorBarMinimum | double | 0.0 |
| attribute | nitrate_l_error | long_name | String | Mole Concentration Of Nitrate In Sea Water Standard Error |
| attribute | nitrate_l_error | missing_value | double | NaN |
| variable | nitrite | double | ||
| attribute | nitrite | _FillValue | double | NaN |
| attribute | nitrite | actual_range | double | -0.19, 75.97 |
| attribute | nitrite | ancillary_variables | String | nitrite_qc |
| attribute | nitrite | C_format | String | %.2f |
| attribute | nitrite | C_format_source | String | input_file |
| attribute | nitrite | long_name | String | Moles Of Nitrite Per Unit Mass In Sea Water |
| attribute | nitrite | missing_value | double | NaN |
| attribute | nitrite | standard_name | String | moles_of_nitrite_per_unit_mass_in_sea_water |
| attribute | nitrite | units | String | µmole/kg |
| attribute | nitrite | whp_name | String | NITRIT |
| attribute | nitrite | whp_unit | String | UMOL/KG |
| variable | nitrite_qc | byte | ||
| attribute | nitrite_qc | _FillValue | byte | 9 |
| attribute | nitrite_qc | actual_range | byte | 0, 36 |
| attribute | nitrite_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrite_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrite_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | nitrite_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | nitrite_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | nitrite_qc | long_name | String | Status Flag |
| attribute | nitrite_qc | standard_name | String | status_flag |
| variable | nitrite_error | double | ||
| attribute | nitrite_error | actual_range | double | 0.0, 0.05 |
| attribute | nitrite_error | colorBarMaximum | double | 50.0 |
| attribute | nitrite_error | colorBarMinimum | double | 0.0 |
| attribute | nitrite_error | long_name | String | Moles Of Nitrite Per Unit Mass In Sea Water Standard Error |
| attribute | nitrite_error | missing_value | double | NaN |
| attribute | nitrite_error | units | String | µmole/kg |
| variable | nitrite_l | double | ||
| attribute | nitrite_l | colorBarMaximum | double | 1.0 |
| attribute | nitrite_l | colorBarMinimum | double | 0.0 |
| attribute | nitrite_l | long_name | String | Mole Concentration Of Nitrite In Sea Water |
| attribute | nitrite_l | missing_value | double | NaN |
| variable | nitrite_l_qc | byte | ||
| attribute | nitrite_l_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrite_l_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrite_l_qc | long_name | String | Status Flag |
| variable | nitrite_l_error | double | ||
| attribute | nitrite_l_error | colorBarMaximum | double | 0.1 |
| attribute | nitrite_l_error | colorBarMinimum | double | 0.0 |
| attribute | nitrite_l_error | long_name | String | Mole Concentration Of Nitrite In Sea Water Standard Error |
| attribute | nitrite_l_error | missing_value | double | NaN |
| variable | phosphate | double | ||
| attribute | phosphate | _FillValue | double | NaN |
| attribute | phosphate | actual_range | double | -9.0, 75.94 |
| attribute | phosphate | ancillary_variables | String | phosphate_qc |
| attribute | phosphate | C_format | String | %.2f |
| attribute | phosphate | C_format_source | String | input_file |
| attribute | phosphate | long_name | String | Moles Of Phosphate Per Unit Mass In Sea Water |
| attribute | phosphate | missing_value | double | NaN |
| attribute | phosphate | standard_name | String | moles_of_phosphate_per_unit_mass_in_sea_water |
| attribute | phosphate | units | String | µmole/kg |
| attribute | phosphate | whp_name | String | PHSPHT |
| attribute | phosphate | whp_unit | String | UMOL/KG |
| variable | phosphate_qc | byte | ||
| attribute | phosphate_qc | _FillValue | byte | 9 |
| attribute | phosphate_qc | actual_range | byte | 0, 7 |
| attribute | phosphate_qc | colorBarMaximum | double | 10.0 |
| attribute | phosphate_qc | colorBarMinimum | double | 0.0 |
| attribute | phosphate_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | phosphate_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | phosphate_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | phosphate_qc | long_name | String | Status Flag |
| attribute | phosphate_qc | standard_name | String | status_flag |
| variable | phosphate_error | double | ||
| attribute | phosphate_error | actual_range | double | 0.0, 0.826 |
| attribute | phosphate_error | colorBarMaximum | double | 50.0 |
| attribute | phosphate_error | colorBarMinimum | double | 0.0 |
| attribute | phosphate_error | long_name | String | Moles Of Phosphate Per Unit Mass In Sea Water Standard Error |
| attribute | phosphate_error | missing_value | double | NaN |
| attribute | phosphate_error | units | String | µmole/kg |
| variable | phosphate_l | double | ||
| attribute | phosphate_l | actual_range | double | 0.0, 3.7 |
| attribute | phosphate_l | colorBarMaximum | double | 4.0 |
| attribute | phosphate_l | colorBarMinimum | double | 0.0 |
| attribute | phosphate_l | long_name | String | Mole Concentration Of Phosphate In Sea Water |
| attribute | phosphate_l | missing_value | double | NaN |
| variable | phosphate_l_qc | byte | ||
| attribute | phosphate_l_qc | actual_range | byte | 2, 5 |
| attribute | phosphate_l_qc | colorBarMaximum | double | 10.0 |
| attribute | phosphate_l_qc | colorBarMinimum | double | 0.0 |
| attribute | phosphate_l_qc | long_name | String | Status Flag |
| variable | phosphate_l_error | double | ||
| attribute | phosphate_l_error | colorBarMaximum | double | 0.1 |
| attribute | phosphate_l_error | colorBarMinimum | double | 0.0 |
| attribute | phosphate_l_error | long_name | String | Mole Concentration Of Phosphate In Sea Water Standard Error |
| attribute | phosphate_l_error | missing_value | double | NaN |
| variable | nitrite_nitrate | double | ||
| attribute | nitrite_nitrate | actual_range | double | -0.23, 82.62 |
| attribute | nitrite_nitrate | long_name | String | Moles Of Nitrate And Nitrite Per Unit Mass In Sea Water |
| attribute | nitrite_nitrate | missing_value | double | NaN |
| attribute | nitrite_nitrate | units | String | µmole/kg |
| variable | nitrite_nitrate_qc | byte | ||
| attribute | nitrite_nitrate_qc | actual_range | byte | 1, 7 |
| attribute | nitrite_nitrate_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrite_nitrate_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrite_nitrate_qc | long_name | String | Status Flag |
| variable | nitrite_nitrate_l | double | ||
| attribute | nitrite_nitrate_l | actual_range | double | 0.0, 37.5 |
| attribute | nitrite_nitrate_l | long_name | String | Mole Concentration Of Nitrate And Nitrite In Sea Water |
| attribute | nitrite_nitrate_l | missing_value | double | NaN |
| variable | nitrite_nitrate_l_qc | byte | ||
| attribute | nitrite_nitrate_l_qc | actual_range | byte | 2, 5 |
| attribute | nitrite_nitrate_l_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrite_nitrate_l_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrite_nitrate_l_qc | long_name | String | Status Flag |
| variable | cfc_11 | double | ||
| attribute | cfc_11 | _FillValue | double | NaN |
| attribute | cfc_11 | actual_range | double | -99.0, 123.585 |
| attribute | cfc_11 | ancillary_variables | String | cfc_11_qc |
| attribute | cfc_11 | C_format | String | %.3f |
| attribute | cfc_11 | C_format_source | String | input_file |
| attribute | cfc_11 | long_name | String | Moles Of Cfc11 Per Unit Mass In Sea Water |
| attribute | cfc_11 | missing_value | double | NaN |
| attribute | cfc_11 | standard_name | String | moles_of_cfc11_per_unit_mass_in_sea_water |
| attribute | cfc_11 | units | String | pmol/kg |
| attribute | cfc_11 | whp_name | String | CFC-11 |
| attribute | cfc_11 | whp_unit | String | PMOL/KG |
| variable | cfc_11_qc | byte | ||
| attribute | cfc_11_qc | _FillValue | byte | 9 |
| attribute | cfc_11_qc | actual_range | byte | 0, 25 |
| attribute | cfc_11_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_11_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_11_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | cfc_11_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | cfc_11_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | cfc_11_qc | long_name | String | Status Flag |
| attribute | cfc_11_qc | standard_name | String | status_flag |
| variable | cfc_11_error | double | ||
| attribute | cfc_11_error | actual_range | double | 0.0, 0.009 |
| attribute | cfc_11_error | colorBarMaximum | double | 50.0 |
| attribute | cfc_11_error | colorBarMinimum | double | 0.0 |
| attribute | cfc_11_error | long_name | String | Moles Of Cfc11 Per Unit Mass In Sea Water Standard Error |
| attribute | cfc_11_error | missing_value | double | NaN |
| variable | cfc_11_l | double | ||
| attribute | cfc_11_l | actual_range | double | 0.0, 5.492 |
| attribute | cfc_11_l | long_name | String | CFC 11 L |
| attribute | cfc_11_l | missing_value | double | NaN |
| variable | cfc_11_l_qc | byte | ||
| attribute | cfc_11_l_qc | actual_range | byte | 1, 6 |
| attribute | cfc_11_l_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_11_l_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_11_l_qc | long_name | String | Status Flag |
| variable | cfc_12 | double | ||
| attribute | cfc_12 | _FillValue | double | NaN |
| attribute | cfc_12 | actual_range | double | -144.057, 99.0 |
| attribute | cfc_12 | ancillary_variables | String | cfc_12_qc |
| attribute | cfc_12 | C_format | String | %.3f |
| attribute | cfc_12 | C_format_source | String | input_file |
| attribute | cfc_12 | long_name | String | CFC 12 |
| attribute | cfc_12 | missing_value | double | NaN |
| attribute | cfc_12 | units | String | pmol/kg |
| attribute | cfc_12 | whp_name | String | CFC-12 |
| attribute | cfc_12 | whp_unit | String | PMOL/KG |
| variable | cfc_12_qc | byte | ||
| attribute | cfc_12_qc | _FillValue | byte | 9 |
| attribute | cfc_12_qc | actual_range | byte | 0, 25 |
| attribute | cfc_12_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_12_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_12_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | cfc_12_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | cfc_12_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | cfc_12_qc | long_name | String | Status Flag |
| attribute | cfc_12_qc | standard_name | String | status_flag |
| variable | cfc_12_error | double | ||
| attribute | cfc_12_error | actual_range | double | 0.0, 0.007 |
| attribute | cfc_12_error | colorBarMaximum | double | 50.0 |
| attribute | cfc_12_error | colorBarMinimum | double | 0.0 |
| attribute | cfc_12_error | long_name | String | Cfc 12 Error |
| attribute | cfc_12_error | missing_value | double | NaN |
| variable | cfc_12_l | double | ||
| attribute | cfc_12_l | actual_range | double | 0.001, 2.695 |
| attribute | cfc_12_l | long_name | String | CFC 12 L |
| attribute | cfc_12_l | missing_value | double | NaN |
| variable | cfc_12_l_qc | byte | ||
| attribute | cfc_12_l_qc | actual_range | byte | 1, 6 |
| attribute | cfc_12_l_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_12_l_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_12_l_qc | long_name | String | Status Flag |
| variable | cfc_113 | double | ||
| attribute | cfc_113 | actual_range | double | -99.0, 41.024 |
| attribute | cfc_113 | long_name | String | CFC 113 |
| attribute | cfc_113 | missing_value | double | NaN |
| variable | cfc_113_qc | byte | ||
| attribute | cfc_113_qc | actual_range | byte | 1, 25 |
| attribute | cfc_113_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_113_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_113_qc | long_name | String | Status Flag |
| variable | cfc_113_error | double | ||
| attribute | cfc_113_error | colorBarMaximum | double | 50.0 |
| attribute | cfc_113_error | colorBarMinimum | double | 0.0 |
| attribute | cfc_113_error | long_name | String | Cfc 113 Error |
| attribute | cfc_113_error | missing_value | double | NaN |
| variable | cfc_113_l | double | ||
| attribute | cfc_113_l | actual_range | double | -0.01, 0.511 |
| attribute | cfc_113_l | long_name | String | CFC 113 L |
| attribute | cfc_113_l | missing_value | double | NaN |
| variable | cfc_113_l_qc | byte | ||
| attribute | cfc_113_l_qc | actual_range | byte | 1, 6 |
| attribute | cfc_113_l_qc | colorBarMaximum | double | 10.0 |
| attribute | cfc_113_l_qc | colorBarMinimum | double | 0.0 |
| attribute | cfc_113_l_qc | long_name | String | Status Flag |
| variable | sulfur_hexifluoride | double | ||
| attribute | sulfur_hexifluoride | _FillValue | double | NaN |
| attribute | sulfur_hexifluoride | actual_range | double | -174.171, 109.992 |
| attribute | sulfur_hexifluoride | ancillary_variables | String | sulfur_hexifluoride_qc |
| attribute | sulfur_hexifluoride | C_format | String | %.4f |
| attribute | sulfur_hexifluoride | C_format_source | String | input_file |
| attribute | sulfur_hexifluoride | long_name | String | Sulfur Hexifluoride |
| attribute | sulfur_hexifluoride | missing_value | double | NaN |
| attribute | sulfur_hexifluoride | units | String | fmol/kg |
| attribute | sulfur_hexifluoride | whp_name | String | SF6 |
| attribute | sulfur_hexifluoride | whp_unit | String | FMOL/KG |
| variable | sulfur_hexifluoride_qc | byte | ||
| attribute | sulfur_hexifluoride_qc | _FillValue | byte | 9 |
| attribute | sulfur_hexifluoride_qc | actual_range | byte | 1, 25 |
| attribute | sulfur_hexifluoride_qc | colorBarMaximum | double | 10.0 |
| attribute | sulfur_hexifluoride_qc | colorBarMinimum | double | 0.0 |
| attribute | sulfur_hexifluoride_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | sulfur_hexifluoride_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | sulfur_hexifluoride_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | sulfur_hexifluoride_qc | long_name | String | Status Flag |
| attribute | sulfur_hexifluoride_qc | standard_name | String | status_flag |
| variable | sulfur_hexifluoride_l | double | ||
| attribute | sulfur_hexifluoride_l | long_name | String | Sulfur Hexifluoride L |
| attribute | sulfur_hexifluoride_l | missing_value | double | NaN |
| variable | sulfur_hexifluoride_l_qc | byte | ||
| attribute | sulfur_hexifluoride_l_qc | actual_range | byte | 1, 1 |
| attribute | sulfur_hexifluoride_l_qc | colorBarMaximum | double | 10.0 |
| attribute | sulfur_hexifluoride_l_qc | colorBarMinimum | double | 0.0 |
| attribute | sulfur_hexifluoride_l_qc | long_name | String | Status Flag |
| variable | total_carbon | double | ||
| attribute | total_carbon | _FillValue | double | NaN |
| attribute | total_carbon | actual_range | double | -999.0, 24870.6 |
| attribute | total_carbon | ancillary_variables | String | total_carbon_qc |
| attribute | total_carbon | C_format | String | %.1f |
| attribute | total_carbon | C_format_source | String | input_file |
| attribute | total_carbon | long_name | String | Moles Of Dissolved Inorganic Carbon Per Unit Mass In Sea Water |
| attribute | total_carbon | missing_value | double | NaN |
| attribute | total_carbon | standard_name | String | moles_of_dissolved_inorganic_carbon_per_unit_mass_in_sea_water |
| attribute | total_carbon | units | String | µmole/kg |
| attribute | total_carbon | whp_name | String | TCARBN |
| attribute | total_carbon | whp_unit | String | UMOL/KG |
| variable | total_carbon_qc | byte | ||
| attribute | total_carbon_qc | _FillValue | byte | 9 |
| attribute | total_carbon_qc | actual_range | byte | 0, 25 |
| attribute | total_carbon_qc | colorBarMaximum | double | 10.0 |
| attribute | total_carbon_qc | colorBarMinimum | double | 0.0 |
| attribute | total_carbon_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | total_carbon_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | total_carbon_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | total_carbon_qc | long_name | String | Status Flag |
| attribute | total_carbon_qc | standard_name | String | status_flag |
| variable | total_alkalinity | double | ||
| attribute | total_alkalinity | _FillValue | double | NaN |
| attribute | total_alkalinity | actual_range | double | -999.0, 6092.0 |
| attribute | total_alkalinity | ancillary_variables | String | total_alkalinity_qc |
| attribute | total_alkalinity | C_format | String | %.1f |
| attribute | total_alkalinity | C_format_source | String | input_file |
| attribute | total_alkalinity | long_name | String | Total Alkalinity |
| attribute | total_alkalinity | missing_value | double | NaN |
| attribute | total_alkalinity | units | String | µmole/kg |
| attribute | total_alkalinity | whp_name | String | ALKALI |
| attribute | total_alkalinity | whp_unit | String | UMOL/KG |
| variable | total_alkalinity_qc | byte | ||
| attribute | total_alkalinity_qc | _FillValue | byte | 9 |
| attribute | total_alkalinity_qc | actual_range | byte | 0, 36 |
| attribute | total_alkalinity_qc | colorBarMaximum | double | 10.0 |
| attribute | total_alkalinity_qc | colorBarMinimum | double | 0.0 |
| attribute | total_alkalinity_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | total_alkalinity_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | total_alkalinity_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | total_alkalinity_qc | long_name | String | Status Flag |
| attribute | total_alkalinity_qc | standard_name | String | status_flag |
| variable | fco2 | double | ||
| attribute | fco2 | _FillValue | double | NaN |
| attribute | fco2 | actual_range | double | -999.0, 2888.6 |
| attribute | fco2 | ancillary_variables | String | fco2_qc fco2_temperature |
| attribute | fco2 | C_format | String | %.1f |
| attribute | fco2 | C_format_source | String | input_file |
| attribute | fco2 | long_name | String | Fugacity Of Carbon Dioxide In Sea Water |
| attribute | fco2 | missing_value | double | NaN |
| attribute | fco2 | standard_name | String | fugacity_of_carbon_dioxide_in_sea_water |
| attribute | fco2 | units | String | uatm |
| attribute | fco2 | whp_name | String | FCO2 |
| attribute | fco2 | whp_unit | String | UATM |
| variable | fco2_qc | byte | ||
| attribute | fco2_qc | _FillValue | byte | 9 |
| attribute | fco2_qc | actual_range | byte | 1, 6 |
| attribute | fco2_qc | colorBarMaximum | double | 10.0 |
| attribute | fco2_qc | colorBarMinimum | double | 0.0 |
| attribute | fco2_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | fco2_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | fco2_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | fco2_qc | long_name | String | Status Flag |
| attribute | fco2_qc | standard_name | String | status_flag |
| variable | fco2_temperature | double | ||
| attribute | fco2_temperature | _FillValue | double | NaN |
| attribute | fco2_temperature | actual_range | double | -1.834, 20.0 |
| attribute | fco2_temperature | C_format | String | %.2f |
| attribute | fco2_temperature | C_format_source | String | input_file |
| attribute | fco2_temperature | colorBarMaximum | double | 40.0 |
| attribute | fco2_temperature | colorBarMinimum | double | -10.0 |
| attribute | fco2_temperature | long_name | String | Temperature Of Analysis Of Sea Water |
| attribute | fco2_temperature | missing_value | double | NaN |
| attribute | fco2_temperature | standard_name | String | temperature_of_analysis_of_sea_water |
| attribute | fco2_temperature | units | String | degree_C |
| attribute | fco2_temperature | whp_name | String | FCO2TMP |
| attribute | fco2_temperature | whp_unit | String | DEG C |
| variable | fco2_temperature_qc | byte | ||
| attribute | fco2_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | fco2_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | fco2_temperature_qc | long_name | String | Status Flag |
| variable | partial_pressure_of_co2 | double | ||
| attribute | partial_pressure_of_co2 | actual_range | double | 173.0, 2617.9 |
| attribute | partial_pressure_of_co2 | long_name | String | Partial Pressure Of Carbon Dioxide In Sea Water |
| attribute | partial_pressure_of_co2 | missing_value | double | NaN |
| variable | partial_pressure_of_co2_qc | byte | ||
| attribute | partial_pressure_of_co2_qc | actual_range | byte | 2, 6 |
| attribute | partial_pressure_of_co2_qc | colorBarMaximum | double | 10.0 |
| attribute | partial_pressure_of_co2_qc | colorBarMinimum | double | 0.0 |
| attribute | partial_pressure_of_co2_qc | long_name | String | Status Flag |
| variable | partial_co2_temperature | double | ||
| attribute | partial_co2_temperature | actual_range | double | -1.6718, 20.8 |
| attribute | partial_co2_temperature | colorBarMaximum | double | 40.0 |
| attribute | partial_co2_temperature | colorBarMinimum | double | -10.0 |
| attribute | partial_co2_temperature | long_name | String | Temperature Of Analysis Of Sea Water |
| attribute | partial_co2_temperature | missing_value | double | NaN |
| attribute | partial_co2_temperature | units | String | degree_C |
| variable | partial_co2_temperature_qc | byte | ||
| attribute | partial_co2_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | partial_co2_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | partial_co2_temperature_qc | long_name | String | Status Flag |
| variable | ph_total_h_scale | double | ||
| attribute | ph_total_h_scale | actual_range | double | -999.0, 9.0 |
| attribute | ph_total_h_scale | colorBarMaximum | double | 9.0 |
| attribute | ph_total_h_scale | colorBarMinimum | double | 7.0 |
| attribute | ph_total_h_scale | long_name | String | Sea Water Ph Reported On Total Scale |
| attribute | ph_total_h_scale | missing_value | double | NaN |
| variable | ph_total_h_scale_qc | byte | ||
| attribute | ph_total_h_scale_qc | actual_range | byte | 0, 6 |
| attribute | ph_total_h_scale_qc | colorBarMaximum | double | 10.0 |
| attribute | ph_total_h_scale_qc | colorBarMinimum | double | 0.0 |
| attribute | ph_total_h_scale_qc | long_name | String | Status Flag |
| variable | ph_unknown_scale | double | ||
| attribute | ph_unknown_scale | actual_range | double | 7.22, 10.3 |
| attribute | ph_unknown_scale | long_name | String | Ph Unknown Scale |
| attribute | ph_unknown_scale | missing_value | double | NaN |
| variable | ph_unknown_scale_qc | byte | ||
| attribute | ph_unknown_scale_qc | actual_range | byte | 2, 6 |
| attribute | ph_unknown_scale_qc | colorBarMaximum | double | 10.0 |
| attribute | ph_unknown_scale_qc | colorBarMinimum | double | 0.0 |
| attribute | ph_unknown_scale_qc | long_name | String | Status Flag |
| variable | ph_sws | double | ||
| attribute | ph_sws | _FillValue | double | NaN |
| attribute | ph_sws | actual_range | double | -9.0, 10.6537 |
| attribute | ph_sws | ancillary_variables | String | ph_sws_qc ph_temperature |
| attribute | ph_sws | C_format | String | %.4f |
| attribute | ph_sws | C_format_source | String | input_file |
| attribute | ph_sws | long_name | String | PH SWS |
| attribute | ph_sws | missing_value | double | NaN |
| attribute | ph_sws | whp_name | String | PH_SWS |
| variable | ph_sws_qc | byte | ||
| attribute | ph_sws_qc | _FillValue | byte | 9 |
| attribute | ph_sws_qc | actual_range | byte | 0, 6 |
| attribute | ph_sws_qc | colorBarMaximum | double | 10.0 |
| attribute | ph_sws_qc | colorBarMinimum | double | 0.0 |
| attribute | ph_sws_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | ph_sws_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | ph_sws_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | ph_sws_qc | long_name | String | Status Flag |
| attribute | ph_sws_qc | standard_name | String | status_flag |
| variable | ph_temperature | double | ||
| attribute | ph_temperature | _FillValue | double | NaN |
| attribute | ph_temperature | actual_range | double | -999.0, 26.26 |
| attribute | ph_temperature | C_format | String | %.2f |
| attribute | ph_temperature | C_format_source | String | input_file |
| attribute | ph_temperature | colorBarMaximum | double | 40.0 |
| attribute | ph_temperature | colorBarMinimum | double | -10.0 |
| attribute | ph_temperature | long_name | String | Temperature Of Analysis Of Sea Water |
| attribute | ph_temperature | missing_value | double | NaN |
| attribute | ph_temperature | standard_name | String | temperature_of_analysis_of_sea_water |
| attribute | ph_temperature | units | String | degree_C |
| attribute | ph_temperature | whp_name | String | PH_TMP |
| attribute | ph_temperature | whp_unit | String | DEG C |
| variable | ph_temperature_qc | byte | ||
| attribute | ph_temperature_qc | actual_range | byte | 1, 5 |
| attribute | ph_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | ph_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | ph_temperature_qc | long_name | String | Status Flag |
| variable | dissolved_organic_carbon | double | ||
| attribute | dissolved_organic_carbon | _FillValue | double | NaN |
| attribute | dissolved_organic_carbon | actual_range | double | -999.0, 423.0 |
| attribute | dissolved_organic_carbon | ancillary_variables | String | dissolved_organic_carbon_qc |
| attribute | dissolved_organic_carbon | C_format | String | %.2f |
| attribute | dissolved_organic_carbon | C_format_source | String | input_file |
| attribute | dissolved_organic_carbon | long_name | String | Dissolved Organic Carbon |
| attribute | dissolved_organic_carbon | missing_value | double | NaN |
| attribute | dissolved_organic_carbon | units | String | µmole/kg |
| attribute | dissolved_organic_carbon | whp_name | String | DOC |
| attribute | dissolved_organic_carbon | whp_unit | String | UMOL/KG |
| variable | dissolved_organic_carbon_qc | byte | ||
| attribute | dissolved_organic_carbon_qc | _FillValue | byte | 9 |
| attribute | dissolved_organic_carbon_qc | actual_range | byte | 0, 9 |
| attribute | dissolved_organic_carbon_qc | colorBarMaximum | double | 10.0 |
| attribute | dissolved_organic_carbon_qc | colorBarMinimum | double | 0.0 |
| attribute | dissolved_organic_carbon_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | dissolved_organic_carbon_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | dissolved_organic_carbon_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | dissolved_organic_carbon_qc | long_name | String | Status Flag |
| attribute | dissolved_organic_carbon_qc | standard_name | String | status_flag |
| variable | tritium_activity | double | ||
| attribute | tritium_activity | long_name | String | Tritium Activity |
| attribute | tritium_activity | missing_value | double | NaN |
| variable | tritium_activity_qc | byte | ||
| attribute | tritium_activity_qc | actual_range | byte | 1, 1 |
| attribute | tritium_activity_qc | colorBarMaximum | double | 10.0 |
| attribute | tritium_activity_qc | colorBarMinimum | double | 0.0 |
| attribute | tritium_activity_qc | long_name | String | Status Flag |
| variable | tritium_activity_error | double | ||
| attribute | tritium_activity_error | colorBarMaximum | double | 50.0 |
| attribute | tritium_activity_error | colorBarMinimum | double | 0.0 |
| attribute | tritium_activity_error | long_name | String | Tritium Activity Error |
| attribute | tritium_activity_error | missing_value | double | NaN |
| variable | tritium | double | ||
| attribute | tritium | _FillValue | double | NaN |
| attribute | tritium | actual_range | double | -9.0, 319.161 |
| attribute | tritium | ancillary_variables | String | tritium_error tritium_qc |
| attribute | tritium | C_format | String | %.3f |
| attribute | tritium | C_format_source | String | input_file |
| attribute | tritium | long_name | String | Tritium |
| attribute | tritium | missing_value | double | NaN |
| attribute | tritium | units | String | 1e-18 |
| attribute | tritium | whp_name | String | TRITUM |
| attribute | tritium | whp_unit | String | TU |
| variable | tritium_qc | byte | ||
| attribute | tritium_qc | _FillValue | byte | 9 |
| attribute | tritium_qc | actual_range | byte | 1, 6 |
| attribute | tritium_qc | colorBarMaximum | double | 10.0 |
| attribute | tritium_qc | colorBarMinimum | double | 0.0 |
| attribute | tritium_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | tritium_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | tritium_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | tritium_qc | long_name | String | Status Flag |
| attribute | tritium_qc | standard_name | String | status_flag |
| variable | tritium_error | double | ||
| attribute | tritium_error | _FillValue | double | NaN |
| attribute | tritium_error | actual_range | double | -9.0, 19.286 |
| attribute | tritium_error | C_format | String | %.3f |
| attribute | tritium_error | C_format_source | String | input_file |
| attribute | tritium_error | colorBarMaximum | double | 0.1 |
| attribute | tritium_error | colorBarMinimum | double | 0.0 |
| attribute | tritium_error | long_name | String | Tritium Error |
| attribute | tritium_error | missing_value | double | NaN |
| attribute | tritium_error | units | String | 1e-18 |
| attribute | tritium_error | whp_name | String | TRITER |
| attribute | tritium_error | whp_unit | String | TU |
| variable | helium | double | ||
| attribute | helium | _FillValue | double | NaN |
| attribute | helium | actual_range | double | -9.0, 47.203 |
| attribute | helium | ancillary_variables | String | helium_error helium_qc |
| attribute | helium | C_format | String | %.4f |
| attribute | helium | C_format_source | String | input_file |
| attribute | helium | long_name | String | Helium |
| attribute | helium | missing_value | double | NaN |
| attribute | helium | units | String | nmol/kg |
| attribute | helium | whp_name | String | HELIUM |
| attribute | helium | whp_unit | String | NMOL/KG |
| variable | helium_qc | byte | ||
| attribute | helium_qc | _FillValue | byte | 9 |
| attribute | helium_qc | actual_range | byte | 1, 8 |
| attribute | helium_qc | colorBarMaximum | double | 10.0 |
| attribute | helium_qc | colorBarMinimum | double | 0.0 |
| attribute | helium_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | helium_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | helium_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | helium_qc | long_name | String | Status Flag |
| attribute | helium_qc | standard_name | String | status_flag |
| variable | helium_error | double | ||
| attribute | helium_error | _FillValue | double | NaN |
| attribute | helium_error | actual_range | double | -0.005, 38.8 |
| attribute | helium_error | C_format | String | %.4f |
| attribute | helium_error | C_format_source | String | input_file |
| attribute | helium_error | colorBarMaximum | double | 50.0 |
| attribute | helium_error | colorBarMinimum | double | 0.0 |
| attribute | helium_error | long_name | String | Helium Error |
| attribute | helium_error | missing_value | double | NaN |
| attribute | helium_error | units | String | nmol/kg |
| attribute | helium_error | whp_name | String | HELIER |
| attribute | helium_error | whp_unit | String | NMOL/KG |
| variable | helium_l | double | ||
| attribute | helium_l | long_name | String | Helium L |
| attribute | helium_l | missing_value | double | NaN |
| variable | helium_l_qc | byte | ||
| attribute | helium_l_qc | actual_range | byte | 1, 1 |
| attribute | helium_l_qc | colorBarMaximum | double | 10.0 |
| attribute | helium_l_qc | colorBarMinimum | double | 0.0 |
| attribute | helium_l_qc | long_name | String | Status Flag |
| variable | delta_helium_3 | double | ||
| attribute | delta_helium_3 | _FillValue | double | NaN |
| attribute | delta_helium_3 | actual_range | double | -99.89, 15579.7 |
| attribute | delta_helium_3 | ancillary_variables | String | delta_helium_3_error delta_helium_3_qc |
| attribute | delta_helium_3 | C_format | String | %.2f |
| attribute | delta_helium_3 | C_format_source | String | input_file |
| attribute | delta_helium_3 | colorBarMaximum | double | 100.0 |
| attribute | delta_helium_3 | colorBarMinimum | double | 0.0 |
| attribute | delta_helium_3 | long_name | String | Delta Helium 3 |
| attribute | delta_helium_3 | missing_value | double | NaN |
| attribute | delta_helium_3 | units | String | percent |
| attribute | delta_helium_3 | whp_name | String | DELHE3 |
| attribute | delta_helium_3 | whp_unit | String | PERCNT |
| variable | delta_helium_3_qc | byte | ||
| attribute | delta_helium_3_qc | _FillValue | byte | 9 |
| attribute | delta_helium_3_qc | actual_range | byte | 1, 7 |
| attribute | delta_helium_3_qc | colorBarMaximum | double | 10.0 |
| attribute | delta_helium_3_qc | colorBarMinimum | double | 0.0 |
| attribute | delta_helium_3_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | delta_helium_3_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | delta_helium_3_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | delta_helium_3_qc | long_name | String | Status Flag |
| attribute | delta_helium_3_qc | standard_name | String | status_flag |
| variable | delta_helium_3_error | double | ||
| attribute | delta_helium_3_error | _FillValue | double | NaN |
| attribute | delta_helium_3_error | actual_range | double | -9.0, 90.25 |
| attribute | delta_helium_3_error | C_format | String | %.2f |
| attribute | delta_helium_3_error | C_format_source | String | input_file |
| attribute | delta_helium_3_error | colorBarMaximum | double | 5.0 |
| attribute | delta_helium_3_error | colorBarMinimum | double | 0.0 |
| attribute | delta_helium_3_error | long_name | String | Delta Helium 3 Error |
| attribute | delta_helium_3_error | missing_value | double | NaN |
| attribute | delta_helium_3_error | units | String | percent |
| attribute | delta_helium_3_error | whp_name | String | DELHER |
| attribute | delta_helium_3_error | whp_unit | String | PERCNT |
| variable | ref_temperature_c | double | ||
| attribute | ref_temperature_c | actual_range | double | -9.0, 31.3464 |
| attribute | ref_temperature_c | colorBarMaximum | double | 32.0 |
| attribute | ref_temperature_c | colorBarMinimum | double | 0.0 |
| attribute | ref_temperature_c | long_name | String | Sea Water Temperature |
| attribute | ref_temperature_c | missing_value | double | NaN |
| attribute | ref_temperature_c | units | String | degree_C |
| variable | ref_temperature_c_qc | byte | ||
| attribute | ref_temperature_c_qc | actual_range | byte | 2, 4 |
| attribute | ref_temperature_c_qc | colorBarMaximum | double | 10.0 |
| attribute | ref_temperature_c_qc | colorBarMinimum | double | 0.0 |
| attribute | ref_temperature_c_qc | long_name | String | Status Flag |
| variable | ref_temperature | double | ||
| attribute | ref_temperature | actual_range | double | -1.85161, 31.3522 |
| attribute | ref_temperature | colorBarMaximum | double | 32.0 |
| attribute | ref_temperature | colorBarMinimum | double | 0.0 |
| attribute | ref_temperature | long_name | String | Sea Water Temperature |
| attribute | ref_temperature | missing_value | double | NaN |
| attribute | ref_temperature | units | String | degree_C |
| variable | ref_temperature_qc | byte | ||
| attribute | ref_temperature_qc | actual_range | byte | 1, 5 |
| attribute | ref_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | ref_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | ref_temperature_qc | long_name | String | Status Flag |
| variable | rev_pressure | double | ||
| attribute | rev_pressure | actual_range | double | -1.0, 6552.0 |
| attribute | rev_pressure | colorBarMaximum | double | 5000.0 |
| attribute | rev_pressure | colorBarMinimum | double | 0.0 |
| attribute | rev_pressure | long_name | String | Sea Water Pressure |
| attribute | rev_pressure | missing_value | double | NaN |
| variable | rev_pressure_qc | byte | ||
| attribute | rev_pressure_qc | actual_range | byte | 2, 6 |
| attribute | rev_pressure_qc | colorBarMaximum | double | 10.0 |
| attribute | rev_pressure_qc | colorBarMinimum | double | 0.0 |
| attribute | rev_pressure_qc | long_name | String | Status Flag |
| variable | rev_temperature_c | double | ||
| attribute | rev_temperature_c | actual_range | double | -0.056, 46.422 |
| attribute | rev_temperature_c | colorBarMaximum | double | 32.0 |
| attribute | rev_temperature_c | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature_c | long_name | String | Sea Water Temperature |
| attribute | rev_temperature_c | missing_value | double | NaN |
| attribute | rev_temperature_c | units | String | degree_C |
| variable | rev_temperature_c_qc | byte | ||
| attribute | rev_temperature_c_qc | actual_range | byte | 2, 5 |
| attribute | rev_temperature_c_qc | colorBarMaximum | double | 10.0 |
| attribute | rev_temperature_c_qc | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature_c_qc | long_name | String | Status Flag |
| variable | rev_temperature | double | ||
| attribute | rev_temperature | actual_range | double | -0.127, 22.445 |
| attribute | rev_temperature | colorBarMaximum | double | 32.0 |
| attribute | rev_temperature | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature | long_name | String | Sea Water Temperature |
| attribute | rev_temperature | missing_value | double | NaN |
| attribute | rev_temperature | units | String | degree_C |
| variable | rev_temperature_qc | byte | ||
| attribute | rev_temperature_qc | actual_range | byte | 2, 2 |
| attribute | rev_temperature_qc | colorBarMaximum | double | 10.0 |
| attribute | rev_temperature_qc | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature_qc | long_name | String | Status Flag |
| variable | rev_temperature_90 | double | ||
| attribute | rev_temperature_90 | actual_range | double | -1.856, 29.935 |
| attribute | rev_temperature_90 | colorBarMaximum | double | 32.0 |
| attribute | rev_temperature_90 | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature_90 | long_name | String | Sea Water Temperature |
| attribute | rev_temperature_90 | missing_value | double | NaN |
| attribute | rev_temperature_90 | units | String | degree_C |
| variable | rev_temperature_90_qc | byte | ||
| attribute | rev_temperature_90_qc | actual_range | byte | 2, 6 |
| attribute | rev_temperature_90_qc | colorBarMaximum | double | 10.0 |
| attribute | rev_temperature_90_qc | colorBarMinimum | double | 0.0 |
| attribute | rev_temperature_90_qc | long_name | String | Status Flag |
| variable | del_carbon_13_dic | double | ||
| attribute | del_carbon_13_dic | _FillValue | double | NaN |
| attribute | del_carbon_13_dic | actual_range | double | -9.0, 4.21 |
| attribute | del_carbon_13_dic | ancillary_variables | String | del_carbon_13_dic_qc |
| attribute | del_carbon_13_dic | C_format | String | %.2f |
| attribute | del_carbon_13_dic | C_format_source | String | input_file |
| attribute | del_carbon_13_dic | long_name | String | Del Carbon 13 Dic |
| attribute | del_carbon_13_dic | missing_value | double | NaN |
| attribute | del_carbon_13_dic | units | String | 1e-3 |
| attribute | del_carbon_13_dic | whp_name | String | DELC13 |
| attribute | del_carbon_13_dic | whp_unit | String | /MILLE |
| variable | del_carbon_13_dic_qc | byte | ||
| attribute | del_carbon_13_dic_qc | _FillValue | byte | 9 |
| attribute | del_carbon_13_dic_qc | actual_range | byte | 1, 9 |
| attribute | del_carbon_13_dic_qc | colorBarMaximum | double | 10.0 |
| attribute | del_carbon_13_dic_qc | colorBarMinimum | double | 0.0 |
| attribute | del_carbon_13_dic_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | del_carbon_13_dic_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | del_carbon_13_dic_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | del_carbon_13_dic_qc | long_name | String | Status Flag |
| attribute | del_carbon_13_dic_qc | standard_name | String | status_flag |
| variable | del_carbon_13_dic_error | double | ||
| attribute | del_carbon_13_dic_error | actual_range | double | 0.0, 0.08 |
| attribute | del_carbon_13_dic_error | colorBarMaximum | double | 0.1 |
| attribute | del_carbon_13_dic_error | colorBarMinimum | double | 0.0 |
| attribute | del_carbon_13_dic_error | long_name | String | Del Carbon 13 Dic Error |
| attribute | del_carbon_13_dic_error | missing_value | double | NaN |
| variable | del_carbon_14_dic | double | ||
| attribute | del_carbon_14_dic | _FillValue | double | NaN |
| attribute | del_carbon_14_dic | actual_range | double | -979.1, 7715.0 |
| attribute | del_carbon_14_dic | ancillary_variables | String | del_carbon_14_dic_qc |
| attribute | del_carbon_14_dic | C_format | String | %.0f |
| attribute | del_carbon_14_dic | C_format_source | String | input_file |
| attribute | del_carbon_14_dic | long_name | String | Del Carbon 14 Dic |
| attribute | del_carbon_14_dic | missing_value | double | NaN |
| attribute | del_carbon_14_dic | units | String | 1e-3 |
| attribute | del_carbon_14_dic | whp_name | String | DELC14 |
| attribute | del_carbon_14_dic | whp_unit | String | /MILLE |
| variable | del_carbon_14_dic_qc | byte | ||
| attribute | del_carbon_14_dic_qc | _FillValue | byte | 9 |
| attribute | del_carbon_14_dic_qc | actual_range | byte | 1, 6 |
| attribute | del_carbon_14_dic_qc | colorBarMaximum | double | 10.0 |
| attribute | del_carbon_14_dic_qc | colorBarMinimum | double | 0.0 |
| attribute | del_carbon_14_dic_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | del_carbon_14_dic_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | del_carbon_14_dic_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | del_carbon_14_dic_qc | long_name | String | Status Flag |
| attribute | del_carbon_14_dic_qc | standard_name | String | status_flag |
| variable | del_carbon_14_dic_error | double | ||
| attribute | del_carbon_14_dic_error | actual_range | double | -9.0, 71.5 |
| attribute | del_carbon_14_dic_error | colorBarMaximum | double | 0.1 |
| attribute | del_carbon_14_dic_error | colorBarMinimum | double | 0.0 |
| attribute | del_carbon_14_dic_error | long_name | String | Del Carbon 14 Dic Error |
| attribute | del_carbon_14_dic_error | missing_value | double | NaN |
| variable | dissolved_organic_nitrogen | double | ||
| attribute | dissolved_organic_nitrogen | _FillValue | double | NaN |
| attribute | dissolved_organic_nitrogen | actual_range | double | -19.5, 605.6 |
| attribute | dissolved_organic_nitrogen | ancillary_variables | String | dissolved_organic_nitrogen_qc |
| attribute | dissolved_organic_nitrogen | C_format | String | %.0f |
| attribute | dissolved_organic_nitrogen | C_format_source | String | input_file |
| attribute | dissolved_organic_nitrogen | long_name | String | Dissolved Organic Nitrogen |
| attribute | dissolved_organic_nitrogen | missing_value | double | NaN |
| attribute | dissolved_organic_nitrogen | units | String | µmole/kg |
| attribute | dissolved_organic_nitrogen | whp_name | String | DON |
| attribute | dissolved_organic_nitrogen | whp_unit | String | UMOL/KG |
| variable | dissolved_organic_nitrogen_qc | byte | ||
| attribute | dissolved_organic_nitrogen_qc | _FillValue | byte | 9 |
| attribute | dissolved_organic_nitrogen_qc | actual_range | byte | 1, 3 |
| attribute | dissolved_organic_nitrogen_qc | colorBarMaximum | double | 10.0 |
| attribute | dissolved_organic_nitrogen_qc | colorBarMinimum | double | 0.0 |
| attribute | dissolved_organic_nitrogen_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | dissolved_organic_nitrogen_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | dissolved_organic_nitrogen_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | dissolved_organic_nitrogen_qc | long_name | String | Status Flag |
| attribute | dissolved_organic_nitrogen_qc | standard_name | String | status_flag |
| variable | total_organic_carbon | double | ||
| attribute | total_organic_carbon | actual_range | double | 40.77, 82.98 |
| attribute | total_organic_carbon | long_name | String | Total Organic Carbon |
| attribute | total_organic_carbon | missing_value | double | NaN |
| attribute | total_organic_carbon | units | String | µmole/kg |
| variable | total_organic_carbon_qc | byte | ||
| attribute | total_organic_carbon_qc | actual_range | byte | 1, 5 |
| attribute | total_organic_carbon_qc | colorBarMaximum | double | 10.0 |
| attribute | total_organic_carbon_qc | colorBarMinimum | double | 0.0 |
| attribute | total_organic_carbon_qc | long_name | String | Status Flag |
| variable | total_organic_carbon_l | double | ||
| attribute | total_organic_carbon_l | actual_range | double | 28.0, 504.0 |
| attribute | total_organic_carbon_l | long_name | String | Total Organic Carbon L |
| attribute | total_organic_carbon_l | missing_value | double | NaN |
| variable | total_organic_carbon_l_qc | byte | ||
| attribute | total_organic_carbon_l_qc | actual_range | byte | 1, 5 |
| attribute | total_organic_carbon_l_qc | colorBarMaximum | double | 10.0 |
| attribute | total_organic_carbon_l_qc | colorBarMinimum | double | 0.0 |
| attribute | total_organic_carbon_l_qc | long_name | String | Status Flag |
| variable | particulate_organic_carbon | double | ||
| attribute | particulate_organic_carbon | _FillValue | double | NaN |
| attribute | particulate_organic_carbon | actual_range | double | -20.0039896, 943.164 |
| attribute | particulate_organic_carbon | ancillary_variables | String | particulate_organic_carbon_qc |
| attribute | particulate_organic_carbon | C_format | String | %.0f |
| attribute | particulate_organic_carbon | C_format_source | String | input_file |
| attribute | particulate_organic_carbon | long_name | String | Particulate Organic Carbon |
| attribute | particulate_organic_carbon | missing_value | double | NaN |
| attribute | particulate_organic_carbon | units | String | ug/kg |
| attribute | particulate_organic_carbon | whp_name | String | POC |
| attribute | particulate_organic_carbon | whp_unit | String | UG/KG |
| variable | particulate_organic_carbon_qc | byte | ||
| attribute | particulate_organic_carbon_qc | _FillValue | byte | 9 |
| attribute | particulate_organic_carbon_qc | actual_range | byte | 1, 6 |
| attribute | particulate_organic_carbon_qc | colorBarMaximum | double | 10.0 |
| attribute | particulate_organic_carbon_qc | colorBarMinimum | double | 0.0 |
| attribute | particulate_organic_carbon_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | particulate_organic_carbon_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | particulate_organic_carbon_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | particulate_organic_carbon_qc | long_name | String | Status Flag |
| attribute | particulate_organic_carbon_qc | standard_name | String | status_flag |
| variable | particulate_organic_carbon_l | double | ||
| attribute | particulate_organic_carbon_l | actual_range | double | 11.9, 1268.96 |
| attribute | particulate_organic_carbon_l | long_name | String | Particulate Organic Carbon L |
| attribute | particulate_organic_carbon_l | missing_value | double | NaN |
| variable | particulate_organic_carbon_l_qc | byte | ||
| attribute | particulate_organic_carbon_l_qc | actual_range | byte | 1, 6 |
| attribute | particulate_organic_carbon_l_qc | colorBarMaximum | double | 10.0 |
| attribute | particulate_organic_carbon_l_qc | colorBarMinimum | double | 0.0 |
| attribute | particulate_organic_carbon_l_qc | long_name | String | Status Flag |
| variable | particulate_organic_nitrogen | double | ||
| attribute | particulate_organic_nitrogen | actual_range | double | -5.10261987, 153.483 |
| attribute | particulate_organic_nitrogen | long_name | String | Particulate Organic Nitrogen |
| attribute | particulate_organic_nitrogen | missing_value | double | NaN |
| variable | particulate_organic_nitrogen_qc | byte | ||
| attribute | particulate_organic_nitrogen_qc | actual_range | byte | 1, 6 |
| attribute | particulate_organic_nitrogen_qc | colorBarMaximum | double | 10.0 |
| attribute | particulate_organic_nitrogen_qc | colorBarMinimum | double | 0.0 |
| attribute | particulate_organic_nitrogen_qc | long_name | String | Status Flag |
| variable | particulate_organic_nitrogen_l | double | ||
| attribute | particulate_organic_nitrogen_l | actual_range | double | -9999.0, 177.84 |
| attribute | particulate_organic_nitrogen_l | long_name | String | Particulate Organic Nitrogen L |
| attribute | particulate_organic_nitrogen_l | missing_value | double | NaN |
| variable | particulate_organic_nitrogen_l_qc | byte | ||
| attribute | particulate_organic_nitrogen_l_qc | actual_range | byte | 1, 6 |
| attribute | particulate_organic_nitrogen_l_qc | colorBarMaximum | double | 10.0 |
| attribute | particulate_organic_nitrogen_l_qc | colorBarMinimum | double | 0.0 |
| attribute | particulate_organic_nitrogen_l_qc | long_name | String | Status Flag |
| variable | particulate_organic_nitrogen_mol | double | ||
| attribute | particulate_organic_nitrogen_mol | long_name | String | Particulate Organic Nitrogen Mol |
| attribute | particulate_organic_nitrogen_mol | missing_value | double | NaN |
| variable | particulate_organic_nitrogen_mol_qc | byte | ||
| attribute | particulate_organic_nitrogen_mol_qc | colorBarMaximum | double | 10.0 |
| attribute | particulate_organic_nitrogen_mol_qc | colorBarMinimum | double | 0.0 |
| attribute | particulate_organic_nitrogen_mol_qc | long_name | String | Status Flag |
| variable | total_dissolved_nitrogen | double | ||
| attribute | total_dissolved_nitrogen | _FillValue | double | NaN |
| attribute | total_dissolved_nitrogen | actual_range | double | -999.0, 88.43 |
| attribute | total_dissolved_nitrogen | ancillary_variables | String | total_dissolved_nitrogen_qc |
| attribute | total_dissolved_nitrogen | C_format | String | %.2f |
| attribute | total_dissolved_nitrogen | C_format_source | String | input_file |
| attribute | total_dissolved_nitrogen | long_name | String | Total Dissolved Nitrogen |
| attribute | total_dissolved_nitrogen | missing_value | double | NaN |
| attribute | total_dissolved_nitrogen | units | String | µmole/kg |
| attribute | total_dissolved_nitrogen | whp_name | String | TDN |
| attribute | total_dissolved_nitrogen | whp_unit | String | UMOL/KG |
| variable | total_dissolved_nitrogen_qc | byte | ||
| attribute | total_dissolved_nitrogen_qc | _FillValue | byte | 9 |
| attribute | total_dissolved_nitrogen_qc | actual_range | byte | 1, 9 |
| attribute | total_dissolved_nitrogen_qc | colorBarMaximum | double | 10.0 |
| attribute | total_dissolved_nitrogen_qc | colorBarMinimum | double | 0.0 |
| attribute | total_dissolved_nitrogen_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | total_dissolved_nitrogen_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | total_dissolved_nitrogen_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | total_dissolved_nitrogen_qc | long_name | String | Status Flag |
| attribute | total_dissolved_nitrogen_qc | standard_name | String | status_flag |
| variable | del_oxygen_18 | double | ||
| attribute | del_oxygen_18 | actual_range | double | -9.0, 12.46 |
| attribute | del_oxygen_18 | long_name | String | Del Oxygen 18 |
| attribute | del_oxygen_18 | missing_value | double | NaN |
| variable | del_oxygen_18_qc | byte | ||
| attribute | del_oxygen_18_qc | actual_range | byte | 1, 6 |
| attribute | del_oxygen_18_qc | colorBarMaximum | double | 10.0 |
| attribute | del_oxygen_18_qc | colorBarMinimum | double | 0.0 |
| attribute | del_oxygen_18_qc | long_name | String | Status Flag |
| variable | del_oxygen_18_error | double | ||
| attribute | del_oxygen_18_error | actual_range | double | -0.05, 0.18 |
| attribute | del_oxygen_18_error | colorBarMaximum | double | 0.1 |
| attribute | del_oxygen_18_error | colorBarMinimum | double | 0.0 |
| attribute | del_oxygen_18_error | long_name | String | Del Oxygen 18 Error |
| attribute | del_oxygen_18_error | missing_value | double | NaN |
| variable | carbon_tetrachloride | double | ||
| attribute | carbon_tetrachloride | _FillValue | double | NaN |
| attribute | carbon_tetrachloride | actual_range | double | -9.0, 195.674 |
| attribute | carbon_tetrachloride | ancillary_variables | String | carbon_tetrachloride_qc |
| attribute | carbon_tetrachloride | C_format | String | %.3f |
| attribute | carbon_tetrachloride | C_format_source | String | input_file |
| attribute | carbon_tetrachloride | long_name | String | Carbon Tetrachloride |
| attribute | carbon_tetrachloride | missing_value | double | NaN |
| attribute | carbon_tetrachloride | units | String | pmol/kg |
| attribute | carbon_tetrachloride | whp_name | String | CCL4 |
| attribute | carbon_tetrachloride | whp_unit | String | PMOL/KG |
| variable | carbon_tetrachloride_qc | byte | ||
| attribute | carbon_tetrachloride_qc | _FillValue | byte | 9 |
| attribute | carbon_tetrachloride_qc | actual_range | byte | 1, 25 |
| attribute | carbon_tetrachloride_qc | colorBarMaximum | double | 10.0 |
| attribute | carbon_tetrachloride_qc | colorBarMinimum | double | 0.0 |
| attribute | carbon_tetrachloride_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | carbon_tetrachloride_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | carbon_tetrachloride_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | carbon_tetrachloride_qc | long_name | String | Status Flag |
| attribute | carbon_tetrachloride_qc | standard_name | String | status_flag |
| variable | carbon_tetrachloride_error | double | ||
| attribute | carbon_tetrachloride_error | colorBarMaximum | double | 50.0 |
| attribute | carbon_tetrachloride_error | colorBarMinimum | double | 0.0 |
| attribute | carbon_tetrachloride_error | long_name | String | Carbon Tetrachloride Error |
| attribute | carbon_tetrachloride_error | missing_value | double | NaN |
| variable | carbon_tetrachloride_l | double | ||
| attribute | carbon_tetrachloride_l | actual_range | double | -0.002, 7.113 |
| attribute | carbon_tetrachloride_l | long_name | String | Carbon Tetrachloride L |
| attribute | carbon_tetrachloride_l | missing_value | double | NaN |
| variable | carbon_tetrachloride_l_qc | byte | ||
| attribute | carbon_tetrachloride_l_qc | actual_range | byte | 1, 6 |
| attribute | carbon_tetrachloride_l_qc | colorBarMaximum | double | 10.0 |
| attribute | carbon_tetrachloride_l_qc | colorBarMinimum | double | 0.0 |
| attribute | carbon_tetrachloride_l_qc | long_name | String | Status Flag |
| variable | barium | double | ||
| attribute | barium | actual_range | double | 37.0, 158.1 |
| attribute | barium | long_name | String | Barium |
| attribute | barium | missing_value | double | NaN |
| variable | barium_qc | byte | ||
| attribute | barium_qc | actual_range | byte | 1, 4 |
| attribute | barium_qc | colorBarMaximum | double | 10.0 |
| attribute | barium_qc | colorBarMinimum | double | 0.0 |
| attribute | barium_qc | long_name | String | Status Flag |
| variable | barium_l | double | ||
| attribute | barium_l | actual_range | double | 42.6, 106.2 |
| attribute | barium_l | long_name | String | Barium L |
| attribute | barium_l | missing_value | double | NaN |
| variable | barium_l_qc | byte | ||
| attribute | barium_l_qc | actual_range | byte | 2, 2 |
| attribute | barium_l_qc | colorBarMaximum | double | 10.0 |
| attribute | barium_l_qc | colorBarMinimum | double | 0.0 |
| attribute | barium_l_qc | long_name | String | Status Flag |
| variable | ctd_fluor | double | ||
| attribute | ctd_fluor | actual_range | double | -0.275, 33.381 |
| attribute | ctd_fluor | colorBarMaximum | double | 30.0 |
| attribute | ctd_fluor | colorBarMinimum | double | 0.03 |
| attribute | ctd_fluor | colorBarScale | String | Log |
| attribute | ctd_fluor | long_name | String | Mass Concentration Of Chlorophyll In Sea Water |
| attribute | ctd_fluor | missing_value | double | NaN |
| variable | ctd_fluor_qc | byte | ||
| attribute | ctd_fluor_qc | actual_range | byte | 1, 6 |
| attribute | ctd_fluor_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_fluor_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_fluor_qc | long_name | String | Status Flag |
| variable | ctd_fluor_arbitrary | double | ||
| attribute | ctd_fluor_arbitrary | long_name | String | Ctd Fluor Arbitrary |
| attribute | ctd_fluor_arbitrary | missing_value | double | NaN |
| variable | ctd_fluor_arbitrary_qc | byte | ||
| attribute | ctd_fluor_arbitrary_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_fluor_arbitrary_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_fluor_arbitrary_qc | long_name | String | Status Flag |
| variable | ctd_fluor_raw | double | ||
| attribute | ctd_fluor_raw | actual_range | double | -0.212, 33.982 |
| attribute | ctd_fluor_raw | long_name | String | Ctd Fluor Raw |
| attribute | ctd_fluor_raw | missing_value | double | NaN |
| variable | ctd_fluor_raw_qc | byte | ||
| attribute | ctd_fluor_raw_qc | actual_range | byte | 1, 5 |
| attribute | ctd_fluor_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_fluor_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_fluor_raw_qc | long_name | String | Status Flag |
| variable | par | double | ||
| attribute | par | actual_range | double | 0.0, 983.664 |
| attribute | par | colorBarMaximum | double | 70.0 |
| attribute | par | colorBarMinimum | double | 0.0 |
| attribute | par | long_name | String | Downwelling Photosynthetic Photon Flux In Sea Water |
| attribute | par | missing_value | double | NaN |
| variable | par_qc | byte | ||
| attribute | par_qc | actual_range | byte | 1, 4 |
| attribute | par_qc | colorBarMaximum | double | 10.0 |
| attribute | par_qc | colorBarMinimum | double | 0.0 |
| attribute | par_qc | long_name | String | Status Flag |
| variable | par_raw | double | ||
| attribute | par_raw | actual_range | double | 0.0, 965.7 |
| attribute | par_raw | long_name | String | Par Raw |
| attribute | par_raw | missing_value | double | NaN |
| variable | par_raw_qc | byte | ||
| attribute | par_raw_qc | actual_range | byte | 1, 2 |
| attribute | par_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | par_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | par_raw_qc | long_name | String | Status Flag |
| variable | cdomsl | double | ||
| attribute | cdomsl | _FillValue | double | NaN |
| attribute | cdomsl | actual_range | double | 0.0, 0.1865 |
| attribute | cdomsl | ancillary_variables | String | cdomsl_qc |
| attribute | cdomsl | C_format | String | %.4f |
| attribute | cdomsl | C_format_source | String | input_file |
| attribute | cdomsl | long_name | String | Cdomsl |
| attribute | cdomsl | missing_value | double | NaN |
| attribute | cdomsl | units | String | 1/nm |
| attribute | cdomsl | whp_name | String | CDOMSL |
| attribute | cdomsl | whp_unit | String | 1/NM |
| variable | cdomsl_qc | byte | ||
| attribute | cdomsl_qc | _FillValue | byte | 9 |
| attribute | cdomsl_qc | actual_range | byte | 2, 5 |
| attribute | cdomsl_qc | colorBarMaximum | double | 10.0 |
| attribute | cdomsl_qc | colorBarMinimum | double | 0.0 |
| attribute | cdomsl_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | cdomsl_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | cdomsl_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | cdomsl_qc | long_name | String | Status Flag |
| attribute | cdomsl_qc | standard_name | String | status_flag |
| variable | cdomsn | double | ||
| attribute | cdomsn | _FillValue | double | NaN |
| attribute | cdomsn | actual_range | double | 0.0, 0.1058 |
| attribute | cdomsn | ancillary_variables | String | cdomsn_qc |
| attribute | cdomsn | C_format | String | %.4f |
| attribute | cdomsn | C_format_source | String | input_file |
| attribute | cdomsn | long_name | String | Cdomsn |
| attribute | cdomsn | missing_value | double | NaN |
| attribute | cdomsn | units | String | 1/nm |
| attribute | cdomsn | whp_name | String | CDOMSN |
| attribute | cdomsn | whp_unit | String | 1/NM |
| variable | cdomsn_qc | byte | ||
| attribute | cdomsn_qc | _FillValue | byte | 9 |
| attribute | cdomsn_qc | actual_range | byte | 2, 5 |
| attribute | cdomsn_qc | colorBarMaximum | double | 10.0 |
| attribute | cdomsn_qc | colorBarMinimum | double | 0.0 |
| attribute | cdomsn_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | cdomsn_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | cdomsn_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | cdomsn_qc | long_name | String | Status Flag |
| attribute | cdomsn_qc | standard_name | String | status_flag |
| variable | radium_226 | double | ||
| attribute | radium_226 | actual_range | double | 1.62, 31.6 |
| attribute | radium_226 | long_name | String | Radium 226 |
| attribute | radium_226 | missing_value | double | NaN |
| variable | radium_226_qc | byte | ||
| attribute | radium_226_qc | actual_range | byte | 2, 2 |
| attribute | radium_226_qc | colorBarMaximum | double | 10.0 |
| attribute | radium_226_qc | colorBarMinimum | double | 0.0 |
| attribute | radium_226_qc | long_name | String | Status Flag |
| variable | radium_226_error | double | ||
| attribute | radium_226_error | actual_range | double | 0.16, 0.76 |
| attribute | radium_226_error | colorBarMaximum | double | 0.1 |
| attribute | radium_226_error | colorBarMinimum | double | 0.0 |
| attribute | radium_226_error | long_name | String | Radium 226 Error |
| attribute | radium_226_error | missing_value | double | NaN |
| variable | radium_228 | double | ||
| attribute | radium_228 | actual_range | double | -0.77, 17.51 |
| attribute | radium_228 | long_name | String | Radium 228 |
| attribute | radium_228 | missing_value | double | NaN |
| variable | radium_228_qc | byte | ||
| attribute | radium_228_qc | actual_range | byte | 2, 2 |
| attribute | radium_228_qc | colorBarMaximum | double | 10.0 |
| attribute | radium_228_qc | colorBarMinimum | double | 0.0 |
| attribute | radium_228_qc | long_name | String | Status Flag |
| variable | radium_228_error | double | ||
| attribute | radium_228_error | actual_range | double | 0.21, 1.48 |
| attribute | radium_228_error | colorBarMaximum | double | 0.1 |
| attribute | radium_228_error | colorBarMinimum | double | 0.0 |
| attribute | radium_228_error | long_name | String | Radium 228 Error |
| attribute | radium_228_error | missing_value | double | NaN |
| variable | ctd_transmissometer | double | ||
| attribute | ctd_transmissometer | actual_range | double | 0.0, 101.4 |
| attribute | ctd_transmissometer | long_name | String | Ctd Transmissometer |
| attribute | ctd_transmissometer | missing_value | double | NaN |
| variable | ctd_transmissometer_qc | byte | ||
| attribute | ctd_transmissometer_qc | actual_range | byte | 1, 6 |
| attribute | ctd_transmissometer_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_transmissometer_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_transmissometer_qc | long_name | String | Status Flag |
| variable | ctd_transmissometer_raw | double | ||
| attribute | ctd_transmissometer_raw | actual_range | double | 0.0024, 4.73 |
| attribute | ctd_transmissometer_raw | long_name | String | Ctd Transmissometer Raw |
| attribute | ctd_transmissometer_raw | missing_value | double | NaN |
| variable | ctd_transmissometer_raw_qc | byte | ||
| attribute | ctd_transmissometer_raw_qc | actual_range | byte | 1, 5 |
| attribute | ctd_transmissometer_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_transmissometer_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_transmissometer_raw_qc | long_name | String | Status Flag |
| variable | ctd_beamcp | double | ||
| attribute | ctd_beamcp | actual_range | double | -0.005, 1.5834 |
| attribute | ctd_beamcp | colorBarMaximum | double | 500.0 |
| attribute | ctd_beamcp | colorBarMinimum | double | -500.0 |
| attribute | ctd_beamcp | long_name | String | Volume Beam Attenuation Coefficient Of Radiative Flux In Sea Water Corrected For Pure Water Attenuance |
| attribute | ctd_beamcp | missing_value | double | NaN |
| variable | ctd_beamcp_qc | byte | ||
| attribute | ctd_beamcp_qc | actual_range | byte | 1, 4 |
| attribute | ctd_beamcp_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_beamcp_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_beamcp_qc | long_name | String | Status Flag |
| variable | ctd_beta700 | double | ||
| attribute | ctd_beta700 | colorBarMaximum | double | 500.0 |
| attribute | ctd_beta700 | colorBarMinimum | double | -500.0 |
| attribute | ctd_beta700 | long_name | String | Volume Scattering Function Of Radiative Flux In Sea Water |
| attribute | ctd_beta700 | missing_value | double | NaN |
| variable | ctd_beta700_qc | byte | ||
| attribute | ctd_beta700_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_beta700_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_beta700_qc | long_name | String | Status Flag |
| variable | ctd_beta700_raw | double | ||
| attribute | ctd_beta700_raw | actual_range | double | 0.0, 1.988 |
| attribute | ctd_beta700_raw | long_name | String | Ctd Beta700 Raw |
| attribute | ctd_beta700_raw | missing_value | double | NaN |
| variable | ctd_beta700_raw_qc | byte | ||
| attribute | ctd_beta700_raw_qc | actual_range | byte | 1, 5 |
| attribute | ctd_beta700_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_beta700_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_beta700_raw_qc | long_name | String | Status Flag |
| variable | ctd_bbp700 | double | ||
| attribute | ctd_bbp700 | long_name | String | CTD BBP700 |
| attribute | ctd_bbp700 | missing_value | double | NaN |
| variable | ctd_bbp700_qc | byte | ||
| attribute | ctd_bbp700_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_bbp700_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_bbp700_qc | long_name | String | Status Flag |
| variable | ctd_turbidity_ftu | double | ||
| attribute | ctd_turbidity_ftu | actual_range | double | -0.002, 6.531 |
| attribute | ctd_turbidity_ftu | long_name | String | Ctd Turbidity Ftu |
| attribute | ctd_turbidity_ftu | missing_value | double | NaN |
| variable | ctd_turbidity_ftu_qc | byte | ||
| attribute | ctd_turbidity_ftu_qc | actual_range | byte | 1, 4 |
| attribute | ctd_turbidity_ftu_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_turbidity_ftu_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_turbidity_ftu_qc | long_name | String | Status Flag |
| variable | ctd_turbidity_ntu | double | ||
| attribute | ctd_turbidity_ntu | long_name | String | Sea Water Turbidity |
| attribute | ctd_turbidity_ntu | missing_value | double | NaN |
| variable | ctd_turbidity_ntu_qc | byte | ||
| attribute | ctd_turbidity_ntu_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_turbidity_ntu_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_turbidity_ntu_qc | long_name | String | Status Flag |
| variable | ctd_turbidity_raw | double | ||
| attribute | ctd_turbidity_raw | long_name | String | Ctd Turbidity Raw |
| attribute | ctd_turbidity_raw | missing_value | double | NaN |
| variable | ctd_turbidity_raw_qc | byte | ||
| attribute | ctd_turbidity_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_turbidity_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_turbidity_raw_qc | long_name | String | Status Flag |
| variable | ctd_cdom | double | ||
| attribute | ctd_cdom | actual_range | double | -1.988, 522.174 |
| attribute | ctd_cdom | colorBarMaximum | double | 1.0 |
| attribute | ctd_cdom | colorBarMinimum | double | 0.0 |
| attribute | ctd_cdom | long_name | String | Concentration Of Colored Dissolved Organic Matter In Sea Water Expressed As Equivalent Mass Fraction Of Quinine Sulfate Dihydrate |
| attribute | ctd_cdom | missing_value | double | NaN |
| variable | ctd_cdom_qc | byte | ||
| attribute | ctd_cdom_qc | actual_range | byte | 1, 4 |
| attribute | ctd_cdom_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_cdom_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_cdom_qc | long_name | String | Status Flag |
| variable | ctd_cdom_raw | double | ||
| attribute | ctd_cdom_raw | actual_range | double | 0.0, 4.814 |
| attribute | ctd_cdom_raw | long_name | String | Ctd Cdom Raw |
| attribute | ctd_cdom_raw | missing_value | double | NaN |
| variable | ctd_cdom_raw_qc | byte | ||
| attribute | ctd_cdom_raw_qc | actual_range | byte | 2, 2 |
| attribute | ctd_cdom_raw_qc | colorBarMaximum | double | 10.0 |
| attribute | ctd_cdom_raw_qc | colorBarMinimum | double | 0.0 |
| attribute | ctd_cdom_raw_qc | long_name | String | Status Flag |
| variable | nitrous_oxide | double | ||
| attribute | nitrous_oxide | actual_range | double | -0.66, 113.195 |
| attribute | nitrous_oxide | long_name | String | Nitrous Oxide |
| attribute | nitrous_oxide | missing_value | double | NaN |
| variable | nitrous_oxide_qc | byte | ||
| attribute | nitrous_oxide_qc | actual_range | byte | 1, 6 |
| attribute | nitrous_oxide_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrous_oxide_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrous_oxide_qc | long_name | String | Status Flag |
| variable | nitrous_oxide_l | double | ||
| attribute | nitrous_oxide_l | long_name | String | Nitrous Oxide L |
| attribute | nitrous_oxide_l | missing_value | double | NaN |
| variable | nitrous_oxide_l_qc | byte | ||
| attribute | nitrous_oxide_l_qc | colorBarMaximum | double | 10.0 |
| attribute | nitrous_oxide_l_qc | colorBarMinimum | double | 0.0 |
| attribute | nitrous_oxide_l_qc | long_name | String | Status Flag |
| variable | chlorophyll_a_ug_kg | double | ||
| attribute | chlorophyll_a_ug_kg | _FillValue | double | NaN |
| attribute | chlorophyll_a_ug_kg | actual_range | double | -0.02, 44.88 |
| attribute | chlorophyll_a_ug_kg | ancillary_variables | String | chlorophyll_a_ug_kg_qc |
| attribute | chlorophyll_a_ug_kg | C_format | String | %.2f |
| attribute | chlorophyll_a_ug_kg | C_format_source | String | input_file |
| attribute | chlorophyll_a_ug_kg | colorBarMaximum | double | 1.0 |
| attribute | chlorophyll_a_ug_kg | colorBarMinimum | double | 0.0 |
| attribute | chlorophyll_a_ug_kg | long_name | String | Mass Fraction Of Chlorophyll A In Sea Water |
| attribute | chlorophyll_a_ug_kg | missing_value | double | NaN |
| attribute | chlorophyll_a_ug_kg | standard_name | String | mass_fraction_of_chlorophyll_a_in_sea_water |
| attribute | chlorophyll_a_ug_kg | units | String | ug/kg |
| attribute | chlorophyll_a_ug_kg | whp_name | String | CHLORA |
| attribute | chlorophyll_a_ug_kg | whp_unit | String | UG/KG |
| variable | chlorophyll_a_ug_kg_qc | byte | ||
| attribute | chlorophyll_a_ug_kg_qc | _FillValue | byte | 9 |
| attribute | chlorophyll_a_ug_kg_qc | actual_range | byte | 1, 5 |
| attribute | chlorophyll_a_ug_kg_qc | colorBarMaximum | double | 10.0 |
| attribute | chlorophyll_a_ug_kg_qc | colorBarMinimum | double | 0.0 |
| attribute | chlorophyll_a_ug_kg_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | chlorophyll_a_ug_kg_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | chlorophyll_a_ug_kg_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | chlorophyll_a_ug_kg_qc | long_name | String | Status Flag |
| attribute | chlorophyll_a_ug_kg_qc | standard_name | String | status_flag |
| variable | chlorophyll_a | double | ||
| attribute | chlorophyll_a | actual_range | double | -900.0, 16383.0 |
| attribute | chlorophyll_a | colorBarMaximum | double | 30.0 |
| attribute | chlorophyll_a | colorBarMinimum | double | 0.03 |
| attribute | chlorophyll_a | colorBarScale | String | Log |
| attribute | chlorophyll_a | long_name | String | Mass Concentration Of Chlorophyll A In Sea Water |
| attribute | chlorophyll_a | missing_value | double | NaN |
| variable | chlorophyll_a_qc | byte | ||
| attribute | chlorophyll_a_qc | actual_range | byte | 1, 6 |
| attribute | chlorophyll_a_qc | colorBarMaximum | double | 10.0 |
| attribute | chlorophyll_a_qc | colorBarMinimum | double | 0.0 |
| attribute | chlorophyll_a_qc | long_name | String | Status Flag |
| variable | phaeophytin | double | ||
| attribute | phaeophytin | actual_range | double | -1.09, 4.05 |
| attribute | phaeophytin | long_name | String | Phaeophytin |
| attribute | phaeophytin | missing_value | double | NaN |
| variable | phaeophytin_qc | byte | ||
| attribute | phaeophytin_qc | actual_range | byte | 2, 5 |
| attribute | phaeophytin_qc | colorBarMaximum | double | 10.0 |
| attribute | phaeophytin_qc | colorBarMinimum | double | 0.0 |
| attribute | phaeophytin_qc | long_name | String | Status Flag |
| variable | phaeophytin_ug_l | double | ||
| attribute | phaeophytin_ug_l | actual_range | double | -900.0, 6.46 |
| attribute | phaeophytin_ug_l | long_name | String | Phaeophytin Ug L |
| attribute | phaeophytin_ug_l | missing_value | double | NaN |
| variable | phaeophytin_ug_l_qc | byte | ||
| attribute | phaeophytin_ug_l_qc | actual_range | byte | 2, 6 |
| attribute | phaeophytin_ug_l_qc | colorBarMaximum | double | 10.0 |
| attribute | phaeophytin_ug_l_qc | colorBarMinimum | double | 0.0 |
| attribute | phaeophytin_ug_l_qc | long_name | String | Status Flag |
| variable | argon | double | ||
| attribute | argon | _FillValue | double | NaN |
| attribute | argon | actual_range | double | 9.54, 17.19 |
| attribute | argon | ancillary_variables | String | argon_qc |
| attribute | argon | C_format | String | %.0f |
| attribute | argon | C_format_source | String | input_file |
| attribute | argon | long_name | String | Argon |
| attribute | argon | missing_value | double | NaN |
| attribute | argon | units | String | µmole/kg |
| attribute | argon | whp_name | String | ARGON |
| attribute | argon | whp_unit | String | UMOL/KG |
| variable | argon_qc | byte | ||
| attribute | argon_qc | _FillValue | byte | 9 |
| attribute | argon_qc | actual_range | byte | 1, 6 |
| attribute | argon_qc | colorBarMaximum | double | 10.0 |
| attribute | argon_qc | colorBarMinimum | double | 0.0 |
| attribute | argon_qc | conventions | String | WOCEBOTTLE - WOCE Quality Codes for water sample (bottle) measurements |
| attribute | argon_qc | flag_meanings | String | no_flag_assigned sample_for_this_measurement_was_drawn_from_water_bottle_but_analysis_not_received acceptable_measurement questionable_measurement bad_measurement not_reported mean_of_replicate_measurements manual_chromatographic_peak_measurement irregular_digital_chromatographic_peak_integration sample_not_drawn_for_this_measurement_from_this_bottle |
| attribute | argon_qc | flag_values | byte | 0, 1, 2, 3, 4, 5, 6, 7, 8, 9 |
| attribute | argon_qc | long_name | String | Status Flag |
| attribute | argon_qc | standard_name | String | status_flag |
| variable | argon_error | double | ||
| attribute | argon_error | actual_range | double | 0.01, 0.14 |
| attribute | argon_error | colorBarMaximum | double | 50.0 |
| attribute | argon_error | colorBarMinimum | double | 0.0 |
| attribute | argon_error | long_name | String | Argon Error |
| attribute | argon_error | missing_value | double | NaN |
| attribute | argon_error | units | String | µmole/kg |
| variable | argon_l | double | ||
| attribute | argon_l | long_name | String | Argon L |
| attribute | argon_l | missing_value | double | NaN |
| variable | argon_l_qc | byte | ||
| attribute | argon_l_qc | actual_range | byte | 1, 1 |
| attribute | argon_l_qc | colorBarMaximum | double | 10.0 |
| attribute | argon_l_qc | colorBarMinimum | double | 0.0 |
| attribute | argon_l_qc | long_name | String | Status Flag |
| variable | d15n_no3 | double | ||
| attribute | d15n_no3 | _FillValue | double | NaN |
| attribute | d15n_no3 | actual_range | double | 0.0, 25.32 |
| attribute | d15n_no3 | C_format | String | %9.2f |
| attribute | d15n_no3 | C_format_source | String | input_file |
| attribute | d15n_no3 | colorBarMaximum | double | 50.0 |
| attribute | d15n_no3 | colorBarMinimum | double | 0.0 |
| attribute | d15n_no3 | date_modified | String | 2026-03-30T21:05:49+00:00 |
| attribute | d15n_no3 | long_name | String | Mole Concentration Of Nitrate In Sea Water |
| attribute | d15n_no3 | missing_value | double | NaN |
| attribute | d15n_no3 | standard_name | String | mole_concentration_of_nitrate_in_sea_water |
| attribute | d15n_no3 | units | String | 1e-3 |
| attribute | d15n_no3 | whp_name | String | D15N_NO3 |
| attribute | d15n_no3 | whp_unit | String | /MILLE |
| variable | d15n_no3_qc | byte | ||
| attribute | d15n_no3_qc | actual_range | byte | 1, 5 |
| attribute | d15n_no3_qc | colorBarMaximum | double | 10.0 |
| attribute | d15n_no3_qc | colorBarMinimum | double | 0.0 |
| attribute | d15n_no3_qc | long_name | String | Status Flag |
| variable | d15n_no3_error | double | ||
| attribute | d15n_no3_error | actual_range | double | 0.0, 2.85 |
| attribute | d15n_no3_error | colorBarMaximum | double | 0.1 |
| attribute | d15n_no3_error | colorBarMinimum | double | 0.0 |
| attribute | d15n_no3_error | long_name | String | D15n No3 Error |
| attribute | d15n_no3_error | missing_value | double | NaN |
| variable | d15n_nitrite_nitrate | double | ||
| attribute | d15n_nitrite_nitrate | actual_range | double | 4.54, 18.17 |
| attribute | d15n_nitrite_nitrate | colorBarMaximum | double | 50.0 |
| attribute | d15n_nitrite_nitrate | colorBarMinimum | double | 0.0 |
| attribute | d15n_nitrite_nitrate | long_name | String | Mole Concentration Of Nitrate In Sea Water |
| attribute | d15n_nitrite_nitrate | missing_value | double | NaN |
| attribute | d15n_nitrite_nitrate | standard_name | String | mole_concentration_of_nitrate_in_sea_water |
| variable | d15n_nitrite_nitrate_qc | byte | ||
| attribute | d15n_nitrite_nitrate_qc | actual_range | byte | 1, 2 |
| attribute | d15n_nitrite_nitrate_qc | colorBarMaximum | double | 10.0 |
| attribute | d15n_nitrite_nitrate_qc | colorBarMinimum | double | 0.0 |
| attribute | d15n_nitrite_nitrate_qc | long_name | String | Status Flag |
| variable | d15n_nitrite_nitrate_error | double | ||
| attribute | d15n_nitrite_nitrate_error | colorBarMaximum | double | 0.1 |
| attribute | d15n_nitrite_nitrate_error | colorBarMinimum | double | 0.0 |
| attribute | d15n_nitrite_nitrate_error | long_name | String | D15n Nitrite Nitrate Error |
| attribute | d15n_nitrite_nitrate_error | missing_value | double | NaN |
| variable | d18o_nitrite_nitrate | double | ||
| attribute | d18o_nitrite_nitrate | actual_range | double | 1.44, 16.89 |
| attribute | d18o_nitrite_nitrate | colorBarMaximum | double | 50.0 |
| attribute | d18o_nitrite_nitrate | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrite_nitrate | long_name | String | Mole Concentration Of Nitrate In Sea Water |
| attribute | d18o_nitrite_nitrate | missing_value | double | NaN |
| attribute | d18o_nitrite_nitrate | standard_name | String | mole_concentration_of_nitrate_in_sea_water |
| variable | d18o_nitrite_nitrate_qc | byte | ||
| attribute | d18o_nitrite_nitrate_qc | actual_range | byte | 1, 2 |
| attribute | d18o_nitrite_nitrate_qc | colorBarMaximum | double | 10.0 |
| attribute | d18o_nitrite_nitrate_qc | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrite_nitrate_qc | long_name | String | Status Flag |
| variable | d18o_nitrite_nitrate_error | double | ||
| attribute | d18o_nitrite_nitrate_error | colorBarMaximum | double | 0.1 |
| attribute | d18o_nitrite_nitrate_error | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrite_nitrate_error | long_name | String | D18o Nitrite Nitrate Error |
| attribute | d18o_nitrite_nitrate_error | missing_value | double | NaN |
| variable | d18o_nitrate | double | ||
| attribute | d18o_nitrate | _FillValue | double | NaN |
| attribute | d18o_nitrate | actual_range | double | 0.0, 27.81 |
| attribute | d18o_nitrate | C_format | String | %9.2f |
| attribute | d18o_nitrate | C_format_source | String | input_file |
| attribute | d18o_nitrate | colorBarMaximum | double | 50.0 |
| attribute | d18o_nitrate | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrate | date_modified | String | 2026-03-30T21:05:49+00:00 |
| attribute | d18o_nitrate | long_name | String | Mole Concentration Of Nitrate In Sea Water |
| attribute | d18o_nitrate | missing_value | double | NaN |
| attribute | d18o_nitrate | standard_name | String | mole_concentration_of_nitrate_in_sea_water |
| attribute | d18o_nitrate | units | String | 1e-3 |
| attribute | d18o_nitrate | whp_name | String | D18O_NO3 |
| attribute | d18o_nitrate | whp_unit | String | /MILLE |
| variable | d18o_nitrate_qc | byte | ||
| attribute | d18o_nitrate_qc | actual_range | byte | 1, 5 |
| attribute | d18o_nitrate_qc | colorBarMaximum | double | 10.0 |
| attribute | d18o_nitrate_qc | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrate_qc | long_name | String | Status Flag |
| variable | d18o_nitrate_error | double | ||
| attribute | d18o_nitrate_error | colorBarMaximum | double | 0.1 |
| attribute | d18o_nitrate_error | colorBarMinimum | double | 0.0 |
| attribute | d18o_nitrate_error | long_name | String | D18o Nitrate Error |
| attribute | d18o_nitrate_error | missing_value | double | NaN |
| variable | bottle_time | double | ||
| attribute | bottle_time | actual_range | double | 9.3049422E8, 1.74541896E9 |
| attribute | bottle_time | ioos_category | String | Time |
| attribute | bottle_time | long_name | String | Bottle Time |
| attribute | bottle_time | time_origin | String | 01-JAN-1970 00:00:00 |
| attribute | bottle_time | units | String | seconds since 1970-01-01T00:00:00Z |
| variable | krypton | double | ||
| attribute | krypton | actual_range | double | 2.02, 3.9878 |
| attribute | krypton | long_name | String | Krypton |
| attribute | krypton | missing_value | double | NaN |
| variable | krypton_qc | byte | ||
| attribute | krypton_qc | actual_range | byte | 2, 6 |
| attribute | krypton_qc | colorBarMaximum | double | 10.0 |
| attribute | krypton_qc | colorBarMinimum | double | 0.0 |
| attribute | krypton_qc | long_name | String | Status Flag |
| variable | krypton_error | double | ||
| attribute | krypton_error | actual_range | double | 0.0, 0.0116 |
| attribute | krypton_error | colorBarMaximum | double | 50.0 |
| attribute | krypton_error | colorBarMinimum | double | 0.0 |
| attribute | krypton_error | long_name | String | Krypton Error |
| attribute | krypton_error | missing_value | double | NaN |
| variable | krypton_l | double | ||
| attribute | krypton_l | long_name | String | Krypton L |
| attribute | krypton_l | missing_value | double | NaN |
| variable | krypton_l_qc | byte | ||
| attribute | krypton_l_qc | actual_range | byte | 1, 1 |
| attribute | krypton_l_qc | colorBarMaximum | double | 10.0 |
| attribute | krypton_l_qc | colorBarMinimum | double | 0.0 |
| attribute | krypton_l_qc | long_name | String | Status Flag |
| variable | krypton_l_error | double | ||
| attribute | krypton_l_error | colorBarMaximum | double | 50.0 |
| attribute | krypton_l_error | colorBarMinimum | double | 0.0 |
| attribute | krypton_l_error | long_name | String | Krypton L Error |
| attribute | krypton_l_error | missing_value | double | NaN |
| variable | xenon | double | ||
| attribute | xenon | actual_range | double | 0.26, 0.60463 |
| attribute | xenon | long_name | String | Xenon |
| attribute | xenon | missing_value | double | NaN |
| variable | xenon_qc | byte | ||
| attribute | xenon_qc | actual_range | byte | 2, 6 |
| attribute | xenon_qc | colorBarMaximum | double | 10.0 |
| attribute | xenon_qc | colorBarMinimum | double | 0.0 |
| attribute | xenon_qc | long_name | String | Status Flag |
| variable | xenon_error | double | ||
| attribute | xenon_error | actual_range | double | 0.0, 0.00175 |
| attribute | xenon_error | colorBarMaximum | double | 50.0 |
| attribute | xenon_error | colorBarMinimum | double | 0.0 |
| attribute | xenon_error | long_name | String | Xenon Error |
| attribute | xenon_error | missing_value | double | NaN |
| variable | xenon_l | double | ||
| attribute | xenon_l | long_name | String | Xenon L |
| attribute | xenon_l | missing_value | double | NaN |
| variable | xenon_l_qc | byte | ||
| attribute | xenon_l_qc | actual_range | byte | 1, 1 |
| attribute | xenon_l_qc | colorBarMaximum | double | 10.0 |
| attribute | xenon_l_qc | colorBarMinimum | double | 0.0 |
| attribute | xenon_l_qc | long_name | String | Status Flag |
| variable | xenon_l_error | double | ||
| attribute | xenon_l_error | colorBarMaximum | double | 50.0 |
| attribute | xenon_l_error | colorBarMinimum | double | 0.0 |
| attribute | xenon_l_error | long_name | String | Xenon L Error |
| attribute | xenon_l_error | missing_value | double | NaN |
| variable | profile_type | String | ||
| attribute | profile_type | long_name | String | Profile Type |
| variable | geometry_container | double | ||
| attribute | geometry_container | _FillValue | double | NaN |
| attribute | geometry_container | geometry_type | String | point |
| attribute | geometry_container | long_name | String | Geometry Container |
| attribute | geometry_container | missing_value | double | NaN |
| attribute | geometry_container | node_coordinates | String | longitude latitude |
| variable | N_PROF | long | ||
| attribute | N_PROF | _FillValue | long | 9223372036854775807 |
| attribute | N_PROF | actual_range | long | 0, 190 |
| attribute | N_PROF | long_name | String | N PROF |
| variable | N_LEVELS | long | ||
| attribute | N_LEVELS | _FillValue | long | 9223372036854775807 |
| attribute | N_LEVELS | actual_range | long | 0, 38 |
| attribute | N_LEVELS | long_name | String | N LEVELS |